CymitQuimica logo

CAS 53188-23-1

:

β-D-Fructose

Description:
β-D-Fructose, with the CAS number 53188-23-1, is a naturally occurring simple sugar, specifically a ketose, that is an isomer of fructose. It is a monosaccharide commonly found in many plants, where it plays a crucial role in energy metabolism. This sugar is characterized by its sweet taste, which is sweeter than glucose and sucrose, making it a popular choice as a sweetener in various food products. β-D-Fructose exists predominantly in a cyclic form, specifically as a five-membered ring (furanose), although it can also exist in an open-chain form. It is soluble in water, which enhances its utility in food and beverage applications. The molecule contains multiple hydroxyl (-OH) groups, contributing to its reactivity and ability to participate in various biochemical processes, including glycolysis and the synthesis of other carbohydrates. Additionally, β-D-Fructose is known for its role in the Maillard reaction, which is important in food chemistry for flavor and color development during cooking.
Formula:C6H12O6
InChI:InChI=1S/C6H12O6/c7-1-3-4(9)5(10)6(11,2-8)12-3/h3-5,7-11H,1-2H2/t3-,4-,5+,6-/m1/s1
InChI key:RFSUNEUAIZKAJO-ARQDHWQXSA-N
SMILES:C([C@@H]1[C@H]([C@@H]([C@](O1)(CO)O)O)O)O
Synonyms:
  • β-Levulose
  • β-D-Fructose
Found 5 products.