CymitQuimica logo

CAS 53218-26-1

:

6-bromo-1,3-benzothiazole

Description:
6-Bromo-1,3-benzothiazole is a heterocyclic organic compound characterized by the presence of both bromine and a benzothiazole moiety. The compound features a fused ring system that includes a benzene ring and a thiazole ring, which contributes to its unique chemical properties. The bromine atom, located at the 6-position of the benzothiazole, enhances the compound's reactivity and can influence its biological activity. This substance is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. 6-Bromo-1,3-benzothiazole is often utilized in various applications, including as a building block in organic synthesis, in the development of pharmaceuticals, and as a potential agrochemical. Its structural characteristics allow for diverse reactivity, making it a valuable compound in medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C7H4BrNS
InChI:InChI=1/C7H4BrNS/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H
InChI key:YJOUISWKEOXIMC-UHFFFAOYSA-N
SMILES:c1cc2c(cc1Br)scn2
Synonyms:
  • 6-Bromobenzothiazole
  • 6-bromobenzo[d]thiazole
Found 6 products.