CAS 5324-13-0

2,6-Dibromo-4-chlorophenol

Description:

2,6-Dibromo-4-chlorophenol is an organic compound characterized by its aromatic structure, which includes a phenolic group substituted with two bromine atoms and one chlorine atom. This compound typically appears as a solid, often with a pale yellow to brown color, and is known for its moderate solubility in organic solvents while being less soluble in water. It exhibits properties typical of halogenated phenols, including potential antimicrobial and antifungal activity, making it of interest in various applications, such as biocides and preservatives. The presence of multiple halogen substituents can influence its reactivity, stability, and environmental persistence. Additionally, 2,6-Dibromo-4-chlorophenol may pose health and environmental risks, necessitating careful handling and disposal. Its chemical structure allows for various reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, which can be exploited in synthetic organic chemistry. As with many halogenated compounds, it is important to consider its regulatory status and potential impacts on human health and the environment.

Formula: C₆H₃Br₂ClO

InChI: InChI=1/C6H3Br2ClO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H

SMILES: c1c(cc(c(c1Br)O)Br)Cl

Synonyms:

• Phenol, 2,6-Dibromo-4-Chloro-

2,6-Dibromo-4-chlorophenol

CAS: 5324-13-0

Formula: C₆H₃Br₂ClO

Purity: 98%

Color and Shape: Solid

Molecular weight: 286.3484

Ref: IN-DA00DADZ

2,6-Dibromo-4-chlorophenol

CAS: 5324-13-0

2,6-Dibromo-4-chlorophenol

Formula: C₆H₃Br₂ClO

Purity: 97%

Color and Shape: white powder

Molecular weight: 286.35g/mol

Ref: 54-OR350143

2,6-Dibromo-4-chlorophenol

CAS: 5324-13-0

Formula: C₆H₃Br₂ClO

Purity: 95%

Color and Shape: Solid

Molecular weight: 286.35

Ref: 10-F237305

2,6-Dibromo-4-chlorophenol

Controlled Product

CAS: 5324-13-0

Applications 2,6-Dibromo-4-chlorophenol
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₆H₃Br₂ClO

Color and Shape: Neat

Molecular weight: 286.35

Ref: TR-D425818