CymitQuimica logo

CAS 5324-13-0

:

2,6-Dibromo-4-chlorophenol

Description:
2,6-Dibromo-4-chlorophenol is an organic compound characterized by its aromatic structure, which includes a phenolic group substituted with two bromine atoms and one chlorine atom. This compound typically appears as a solid, often with a pale yellow to brown color, and is known for its moderate solubility in organic solvents while being less soluble in water. It exhibits properties typical of halogenated phenols, including potential antimicrobial and antifungal activity, making it of interest in various applications, such as biocides and preservatives. The presence of multiple halogen substituents can influence its reactivity, stability, and environmental persistence. Additionally, 2,6-Dibromo-4-chlorophenol may pose health and environmental risks, necessitating careful handling and disposal. Its chemical structure allows for various reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, which can be exploited in synthetic organic chemistry. As with many halogenated compounds, it is important to consider its regulatory status and potential impacts on human health and the environment.
Formula:C6H3Br2ClO
InChI:InChI=1/C6H3Br2ClO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H
InChI key:WYZQOLPTPZDTIF-UHFFFAOYSA-N
SMILES:c1c(cc(c(c1Br)O)Br)Cl
Synonyms:
  • Phenol, 2,6-Dibromo-4-Chloro-
Found 5 products.