CymitQuimica logo

CAS 532924-25-7

:

5-chloro-2-nitrophenylboronic acid

Description:
5-Chloro-2-nitrophenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains a chlorine and a nitro substituent. This compound typically appears as a solid and is soluble in polar solvents, such as water and alcohols, due to the boronic acid group. The presence of the chlorine atom and the nitro group introduces electron-withdrawing effects, which can influence its reactivity and interactions in chemical reactions, particularly in Suzuki coupling reactions, where it serves as a key reagent for forming carbon-carbon bonds. Additionally, the boronic acid functionality allows for reversible binding with diols, making it useful in various applications, including drug development and materials science. Its unique structural features contribute to its potential as a building block in organic synthesis and medicinal chemistry. Safety data should be consulted, as with all chemical substances, to ensure proper handling and usage.
Formula:C6H5BClNO4
InChI:InChI=1S/C6H5BClNO4/c8-4-1-2-6(9(12)13)5(3-4)7(10)11/h1-3,10-11H
InChI key:PURYLRLRXKALOG-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Cl)B(O)O)N(=O)=O
Synonyms:
  • (5-Chloro-2-nitrophenyl)boronic acid
  • Boronic acid, (5-chloro-2-nitrophenyl)-
Found 4 products.