CymitQuimica logo

CAS 53296-64-3

:

N-Methyl-N-(trimethylsilyl)heptafluorobutyramide

Description:
N-Methyl-N-(trimethylsilyl)heptafluorobutyramide, with the CAS number 53296-64-3, is a fluorinated organic compound characterized by its unique structure that includes a heptafluorobutyramide moiety and a trimethylsilyl group. This compound is notable for its high fluorine content, which imparts distinct chemical properties such as increased hydrophobicity and thermal stability. The presence of the trimethylsilyl group enhances its volatility and solubility in organic solvents, making it useful in various applications, including as a derivatizing agent in gas chromatography. Additionally, the compound exhibits low reactivity under standard conditions, which can be advantageous in certain analytical procedures. Its fluorinated nature may also contribute to unique interactions in biological systems, although specific biological activity would require further investigation. Overall, N-Methyl-N-(trimethylsilyl)heptafluorobutyramide is a specialized chemical with applications in analytical chemistry and potentially in materials science due to its distinctive properties.
Formula:C8H12F7NOSi
InChI:InChI=1/C8H12F7NOSi/c1-16(18(2,3)4)5(17)6(9,10)7(11,12)8(13,14)15/h1-4H3
InChI key:CMXKINNDZCNCEI-UHFFFAOYSA-N
SMILES:CN(C(=O)C(C(C(F)(F)F)(F)F)(F)F)[Si](C)(C)C
Found 4 products.