CAS 5334-31-6
:3-Amino-1H-pyrazole-4-carboxamide
Description:
3-Amino-1H-pyrazole-4-carboxamide, with the CAS number 5334-31-6, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2) attached to the pyrazole ring, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions and applications. The presence of both amino and carboxamide functional groups allows for hydrogen bonding, influencing its physical properties and interactions with other molecules. This compound is of interest in medicinal chemistry and may exhibit various pharmacological activities, making it a subject of research in drug development. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application.
Formula:C4H6N4O
InChI:InChI=1S/C4H6N4O/c5-3-2(4(6)9)1-7-8-3/h1H,(H2,6,9)(H3,5,7,8)
InChI key:InChIKey=LEFSNWUSTYESGC-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C(N)=NNC1
Synonyms:- 1H-Pyrazole-4-carboxamide, 3-amino-
- 3-Amino-1H-pyrazole-4-carboxamide
- 3-Amino-4-carbamoylpyrazole
- 5-Amino-4-pyrazolecarboxamide
- NSC 1402
- 3-Amino-4-pyrazolecarboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Amino-1H-pyrazole-4-carboxamide
CAS:3-Amino-1H-pyrazole-4-carboxamideFormula:C4H6N4OPurity:98%Color and Shape:SolidMolecular weight:126.116633-Amino-1H-Pyrazole-4-Carboxamide
CAS:Formula:C4H6N4OPurity:97%Color and Shape:SolidMolecular weight:126.1166Allopurinol EP Impurity A
CAS:Formula:C4H6N4OColor and Shape:White To Off-White SolidMolecular weight:126.123-Amino-pyrazole-4-carboxylic acid amide
CAS:Formula:C4H6N4OPurity:95%Color and Shape:White powderMolecular weight:126.1195-Amino-4-pyrazolecarboxamide
CAS:Controlled ProductFormula:C4H6N4OColor and Shape:NeatMolecular weight:126.117Allopurinol impurity A
CAS:Allopurinol is an anticancer drug that is used to treat leukemia and other cancers. Allopurinol impurity A is a byproduct of the production of allopurinol, which has been shown to have anticancer properties. It has been shown to suppress the expression of suppressor genes and up-regulated genes in pancreatic cancer cells. This compound also induces apoptosis in orthotopic liver cells in a process involving activation of caspase 3 and suppression of Akt signaling.Purity:Min. 95%





