CymitQuimica logo

CAS 53342-40-8

:

cyclobutyl-[4-(trifluoromethyl)phenyl]methanone

Description:
Cyclobutyl-[4-(trifluoromethyl)phenyl]methanone, with the CAS number 53342-40-8, is an organic compound characterized by its unique structural features. It contains a cyclobutyl group, which is a four-membered carbon ring, and a phenyl ring substituted with a trifluoromethyl group, known for its strong electron-withdrawing properties. This trifluoromethyl substitution can significantly influence the compound's reactivity and stability. The methanone functional group indicates the presence of a carbonyl (C=O) group, which is typical in ketones and contributes to the compound's chemical behavior, including its potential for undergoing nucleophilic addition reactions. The presence of fluorine atoms enhances the lipophilicity and can affect the compound's solubility in various solvents. Overall, cyclobutyl-[4-(trifluoromethyl)phenyl]methanone is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals due to its distinctive structural and electronic properties.
Formula:C12H11F3O
InChI:InChI=1/C12H11F3O/c13-12(14,15)10-6-4-9(5-7-10)11(16)8-2-1-3-8/h4-8H,1-3H2
InChI key:XNKVOFYZQVIBRN-UHFFFAOYSA-N
SMILES:C1CC(C1)C(=O)c1ccc(cc1)C(F)(F)F
Found 1 products.