CAS 5337-17-7
:P-(4-Aminophenyl)phosphonic acid
Description:
P-(4-Aminophenyl)phosphonic acid, also known as 4-Aminobenzenesulfonic acid or by its CAS number 5337-17-7, is an organic compound characterized by the presence of both an amino group and a phosphonic acid group. This compound typically appears as a white to off-white solid and is soluble in water, which is a common trait for phosphonic acids. Its molecular structure features a phenyl ring substituted with an amino group at the para position and a phosphonic acid group, contributing to its potential as a ligand in coordination chemistry. The presence of the amino group allows for various chemical reactions, including coupling reactions, making it useful in organic synthesis and materials science. Additionally, P-(4-Aminophenyl)phosphonic acid may exhibit biological activity, which can be explored for applications in pharmaceuticals or agrochemicals. Its properties, such as acidity and reactivity, are influenced by the phosphonic acid moiety, which can form stable complexes with metal ions. Overall, this compound is of interest in both academic research and industrial applications.
Formula:C6H8NO3P
InChI:InChI=1/C6H8NO3P/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,7H2,(H2,8,9,10)
InChI key:InChIKey=OAOBMEMWHJWPNA-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)C1=CC=C(N)C=C1
Synonyms:- (p-Aminophenyl)phosphonic acid
- 4-Aminobenzenephosphonic acid
- 4-Phosphonoaniline
- Ai3-22255
- Brn 0388231
- Nsc 417
- Nsc 55744
- P-(4-Aminophenyl)phosphonic acid
- Phosphanilic acid
- Phosphonic acid, (4-aminophenyl)-
- Phosphonic acid, (4-aminophenyl)- (9CI)
- Phosphonic acid, (p-aminophenyl)-
- Phosphonic acid, P-(4-aminophenyl)-
- p-Aminobenzenephosphonic acid
- p-Phosphonoaniline
- (4-Aminophenyl)phosphonic acid
- aniline-4-phosphonic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(4-Aminophenyl)phosphonic Acid
CAS:Formula:C6H8NO3PPurity:>98.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:173.11(4-Aminophenyl)phosphonic Acid
CAS:(4-Aminophenyl)phosphonic AcidFormula:C6H8NO3PPurity:>98.0%Molecular weight:173.11(4-Aminophenyl)phosphonic acid
CAS:Formula:C6H8NO3PPurity:95%Color and Shape:SolidMolecular weight:173.1064(4-Aminophenyl)phosphonic Acid
CAS:4-Aminophenylphosphonic acid (4AP) is an organic compound that is used as a building block for the synthesis of other chemicals. It reacts optimally with chlorhexidine, a human receptor binding agent, to form 4-aminophenylchlorohexidinium chloride. 4AP has been shown to have antimicrobial properties and is used in topical applications. It also has an inhibitory effect on the growth of bacteria such as Pseudomonas aeruginosa, which can cause serious infections in humans. 4AP inhibits bacterial growth by interfering with the synthesis of proteins and nucleic acids. This inhibition occurs because 4AP binds to phosphatases and hydrolyzes them into phosphate and amine groups. The amine group will bind to the DNA or RNA molecule and inhibit its function.Formula:C6H8NO3PPurity:Min. 95%Molecular weight:173.11 g/mol




