CAS 53397-65-2
:5,6,11,12-tetradehydrodibenzo[a,e][8]annulene
Description:
5,6,11,12-tetradehydrodibenzo[a,e][8]annulene is a polycyclic aromatic hydrocarbon characterized by its unique structure, which features a fused ring system comprising multiple benzene-like units. This compound is notable for its tetradehydro configuration, indicating the presence of four fewer hydrogen atoms than its fully saturated counterpart. The molecular structure contributes to its distinct electronic properties, including potential applications in organic electronics and materials science. The compound exhibits a planar geometry, which enhances its stability and facilitates π-π stacking interactions, a key feature in many organic materials. Additionally, due to its conjugated system, it may display interesting optical properties, such as fluorescence or phosphorescence, depending on the specific conditions. Its synthesis and study can provide insights into the behavior of larger polycyclic systems and their potential uses in various fields, including nanotechnology and molecular electronics. As with many organic compounds, its reactivity and stability can be influenced by environmental factors such as temperature and solvent interactions.
Formula:C16H8
InChI:InChI=1/C16H8/c1-2-6-14-11-12-16-8-4-3-7-15(16)10-9-13(14)5-1/h1-8H
SMILES:c1ccc2C#Cc3ccccc3C#Cc2c1
Synonyms:- Dibenzo(a,e)cyclooctene, 5,6,11,12-tetradehydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5,6,11,12-Tetradehydrodibenzo[a,e]cyclooctene
CAS:Formula:C16H8Purity:>98.0%(HPLC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:200.245,6,11,12-Tetradehydrodibenzo[a,e]cyclooctatetraene
CAS:Formula:C16H8Purity:95%Color and Shape:SolidMolecular weight:200.23475,6,11,12-Tetradehydrodibenzo[a,e]cyclooctene
CAS:5,6,11,12-Tetradehydrodibenzo[a,e]cycloocteneFormula:C16H8Purity:95%Molecular weight:200.235,6,11,12-Tetradehydrodibenzo[A,E]Cyclooctene
CAS:5,6,11,12-Tetradehydrodibenzo[A,E]CycloocteneFormula:C16H8Purity:99%Molecular weight:200.235,6,11,12-Tetradehydrodibenzo[a,e]cyclooctene
CAS:Controlled ProductStability Light Sensitive
Applications 5,6,11,12-Tetradehydrodibenzo[a,e]cyclooctene (cas# 53397-65-2) is a useful reagent for efficiently preparing polymer dimers.
References Liu, X., et al.: RSC Adv., 10, 6794 (2020)Formula:C16H8Color and Shape:NeatMolecular weight:200.235,6,11,12-Tetradehydrodibenzo[a,e]cyclooctene
CAS:5,6,11,12-Tetradehydrodibenzo[a,e]cyclooctene is a furan that contains an anion group. It is a molecule with four cyclic structures and two double bonds. The compound functions as an intermediate in the 1,3-dipolar cycloaddition reaction between a diene and a dienophile. 5,6,11,12-Tetradehydrodibenzo[a,e]cyclooctene can be synthesized by the Suzuki reaction between dichloroketene and dimerization of phenolic compounds. The compound has two isomers: 5H-1 and 6H-2. The former is more stable than the latter due to steric hindrance from the methyl group on C5. There are also two oxygen atoms in the molecule's molecular structure; one at C4 and one at C5.Formula:C16H8Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:200.24 g/mol






