CAS 53449-14-2
:7-Chloro-6-nitro-4(3H)-quinazolinone
Description:
7-Chloro-6-nitro-4(3H)-quinazolinone, with the CAS number 53449-14-2, is a heterocyclic organic compound characterized by its quinazolinone structure, which features a fused bicyclic system containing both a benzene and a pyrimidine ring. This compound is notable for its chlorine and nitro substituents, which can influence its chemical reactivity and biological activity. Typically, quinazolinones exhibit a range of pharmacological properties, including antimicrobial, anti-inflammatory, and anticancer activities, making them of interest in medicinal chemistry. The presence of the chlorine atom may enhance lipophilicity, while the nitro group can serve as a potential site for further chemical modifications. In terms of physical properties, quinazolinones generally have moderate solubility in organic solvents and may exhibit varying degrees of stability under different conditions. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, 7-Chloro-6-nitro-4(3H)-quinazolinone represents a compound with significant potential for research and application in various fields of chemistry and pharmacology.
Formula:C8H4ClN3O3
InChI:InChI=1S/C8H4ClN3O3/c9-5-2-6-4(1-7(5)12(14)15)8(13)11-3-10-6/h1-3H,(H,10,11,13)
InChI key:InChIKey=URDYTQYZXZKBQT-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(Cl)=C(N(=O)=O)C2)NC=N1
Synonyms:- 4(1H)-Quinazolinone, 7-chloro-6-nitro-
- 4(3H)-quinazolinone, 7-chloro-6-nitro-
- 4-Quinazolinol, 7-Chloro-6-Nitro-
- 6-Nitro-7-Chloro-4-HydroxyQuinazoline
- 6-Nitro-7-chloro-3,4-dihydroquinazolin-4-one
- 7-Chloro-6-nitro-4(3H)-quinazolinone
- 7-Chloro-6-nitro-4(3H)-quinazolone
- 7-Chloro-6-nitro-4-hydroxyquinazoline
- 7-Chloro-6-nitroquinazolin-4(3H)-one
- 7-Chloro-6-nitroquinazolin-4-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
7-Chloro-6-nitro-4-hydroxyquinazoline
CAS:Formula:C8H4ClN3O3Purity:>98.0%(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:225.597-Chloro-6-nitro-4-hydroxyquinazoline
CAS:Formula:C8H4ClN3O3Purity:95%Color and Shape:SolidMolecular weight:225.58877-Chloro-6-nitroquinazolin-4(1H)-one
CAS:7-Chloro-6-nitroquinazolin-4(1H)-oneFormula:C8H4ClN3O3Purity:97%Color and Shape:Solid-PowderMolecular weight:225.588667-Chloro-6-nitroquinazolin-4(3H)-one
CAS:Formula:C8H4ClN3O3Purity:95%Color and Shape:Liquid, No data available.Molecular weight:225.597-Chloro-6-nitroquinazolin-4(1H)-one
CAS:7-Chloro-6-nitroquinazolin-4(1H)-one is a manipulator that has been shown to be effective in the treatment of epidermal growth. The compound was found to be an efficient inhibitor of protein kinases and histone deacetylases, which are important for the regulation of cellular proliferation. 7-Chloro-6-nitroquinazolin-4(1H)-one is also a nucleophile that reacts with electrophiles such as organic peroxides and nitrosating agents. This reaction leads to the production of reactive oxygen species, which may contribute to its antitumor activity.Formula:C8H4ClN3O3Purity:Min. 95%Molecular weight:225.59 g/mol






