CymitQuimica logo

CAS 53588-95-7

:

tert-butyl (2-cyanoethyl)carbamate

Description:
Tert-butyl (2-cyanoethyl)carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of a carbamic acid with an alcohol. This compound features a tert-butyl group, providing steric hindrance and influencing its reactivity and solubility. The presence of the cyanoethyl group introduces a nitrile functionality, which can participate in various chemical reactions, such as nucleophilic additions. Tert-butyl (2-cyanoethyl)carbamate is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The compound is also notable for its stability under standard conditions, although it should be handled with care due to potential toxicity associated with the cyano group. Overall, its unique structure and functional groups make it a valuable compound in synthetic organic chemistry.
Formula:C8H14N2O2
InChI:InChI=1/C8H14N2O2/c1-8(2,3)12-7(11)10-6-4-5-9/h4,6H2,1-3H3,(H,10,11)
InChI key:NORLFIHQJFOIGS-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NCCC#N)O
Synonyms:
  • carbamic acid, N-(2-cyanoethyl)-, 1,1-dimethylethyl ester
  • tert-Butyl (2-cyanoethyl)carbamate
Found 5 products.