CAS 53600-33-2
:2-Amino-6-methoxybenzoic acid
Description:
2-Amino-6-methoxybenzoic acid, also known as o-aminomethoxybenzoic acid, is an aromatic amino acid derivative characterized by the presence of both an amino group (-NH2) and a methoxy group (-OCH3) on a benzoic acid framework. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The amino group can participate in hydrogen bonding, enhancing its solubility. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the methoxy group can influence the compound's reactivity and biological activity, potentially affecting its role in various chemical reactions. Additionally, 2-amino-6-methoxybenzoic acid may exhibit specific biological properties, making it of interest in medicinal chemistry. As with many chemical substances, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C8H9NO3
InChI:InChI=1/C8H9NO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4H,9H2,1H3,(H,10,11)
SMILES:COc1cccc(c1C(=O)O)N
Synonyms:- Benzoic acid, 2-amino-6-methoxy-
- 2-Amino-6-Methoxybenzoicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Amino-6-methoxybenzoic Acid
CAS:Formula:C8H9NO3Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:167.162-Amino-6-methoxybenzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H9NO3Purity:97%Color and Shape:White to cream or yellow, Crystals or powder or crystalline powderMolecular weight:167.162-Amino-6-methoxybenzoic acid
CAS:Formula:C8H9NO3Purity:98%Color and Shape:SolidMolecular weight:167.16202-Amino-6-methoxybenzoic acid
CAS:2-Amino-6-methoxybenzoic acidFormula:C8H9NO3Purity:98%Color and Shape: solidMolecular weight:167.16g/mol2-Amino-6-methoxybenzoic acid
CAS:Formula:C8H9NO3Purity:98%Color and Shape:Solid, Crystalline PowderMolecular weight:167.1642-Amino-6-methoxybenzoic acid
CAS:2-Amino-6-methoxybenzoic acid is a monosubstituted amide, which is synthesized by the hydrolysis of 2-amino-5-methylbenzoic acid with hydrochloric acid in the presence of diacetate. This compound is formed as part of the biosynthesis of aminophenols and heterocycles. It can be used to adsorb metal ions and organic compounds, such as chloride and butyllithium. 2-Amino-6-methoxybenzoic acid is also found in aeruginosa infections due to its ability to inhibit bacterial growth by inhibiting protein synthesis. The synthesis of this compound requires shikimate pathway enzymes.Formula:C8H9NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:167.16 g/mol





