CymitQuimica logo

CAS 53617-37-1

:

4-(Pyrrolidin-3-yl)morpholine

Description:
4-(Pyrrolidin-3-yl)morpholine, with the CAS number 53617-37-1, is a chemical compound characterized by its unique structure that combines a morpholine ring with a pyrrolidine moiety. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents, which is indicative of its potential for interactions in biological systems. The presence of both nitrogen-containing rings suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, compounds of this type may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. The specific functional groups present in 4-(Pyrrolidin-3-yl)morpholine may also influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). Overall, this compound represents a versatile scaffold for further chemical modifications and potential therapeutic applications.
Formula:C8H16N2O
InChI:InChI=1S/C8H16N2O/c1-2-9-7-8(1)10-3-5-11-6-4-10/h8-9H,1-7H2
InChI key:InChIKey=OPJDRNMJJNFSNZ-UHFFFAOYSA-N
SMILES:C1(CCNC1)N2CCOCC2
Synonyms:
  • 4-(Pyrrolidin-3-Yl)Morpholine
  • Morpholine, 4-(3-pyrrolidinyl)-
  • 4-(3-Pyrrolidinyl)morpholine
Found 5 products.