CymitQuimica logo

CAS 53697-27-1

:

des-acetyl-A-melanocyte stimulating*hormone

Description:
Des-acetyl-A-melanocyte stimulating hormone (des-acetyl-A-MSH) is a peptide hormone that plays a significant role in various physiological processes, particularly in pigmentation and appetite regulation. It is derived from the pro-opiomelanocortin (POMC) precursor and is known for its ability to stimulate melanogenesis, the process of melanin production in melanocytes, which affects skin and hair pigmentation. The absence of the acetyl group in its structure distinguishes it from its acetylated counterpart, influencing its biological activity and receptor binding. Des-acetyl-A-MSH interacts with melanocortin receptors, particularly MC1R, which are involved in skin responses to UV radiation and inflammatory processes. Additionally, it has been studied for its potential effects on energy homeostasis and its role in the central nervous system. The compound is typically characterized by its peptide structure, which consists of a specific sequence of amino acids, and its stability can be influenced by factors such as pH and temperature. Overall, des-acetyl-A-MSH is an important molecule in the field of endocrinology and dermatology.
Formula:C75H107N21O18S
InChI:InChI=1S/C75H107N21O18S/c1-41(2)62(63(78)103)95-73(113)59-19-12-29-96(59)74(114)53(17-9-10-27-76)86-60(100)37-84-65(105)56(33-44-35-83-49-16-8-7-15-47(44)49)92-66(106)50(18-11-28-82-75(79)80)87-69(109)55(31-42-13-5-4-6-14-42)91-71(111)57(34-45-36-81-40-85-45)93-67(107)51(24-25-61(101)102)88-68(108)52(26-30-115-3)89-72(112)58(39-98)94-70(110)54(90-64(104)48(77)38-97)32-43-20-22-46(99)23-21-43/h4-8,13-16,20-23,35-36,40-41,48,50-59,62,83,97-99H,9-12,17-19,24-34,37-39,76-77H2,1-3H3,(H2,78,103)(H,81,85)(H,84,105)(H,86,100)(H,87,109)(H,88,108)(H,89,112)(H,90,104)(H,91,111)(H,92,106)(H,93,107)(H,94,110)(H,95,113)(H,101,102)(H4,79,80,82)/t48-,50-,51-,52-,53-,54-,55-,56-,57-,58-,59-,62+/m0/s1
InChI key:NMMSXFAQJQPZOI-BDQOATHBSA-N
SMILES:CC(C)[C@H](C(=O)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@H](CC2=CNC3=CC=CC=C32)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC4=CC=CC=C4)NC(=O)[C@H](CC5=CN=CN5)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@H](CO)NC(=O)[C@H](CC6=CC=C(C=C6)O)NC(=O)[C@H](CO)N
Synonyms:
  • (Des-acetyl)-.alpha.-MSH
  • H-Ser-Tyr-Ser-Met-Glu-His-Phe-Arg-Trp-Gly-Lys-Pro-Val-NH2
Found 2 products.