CAS 537-55-3: N-Acetyl-L-tyrosine
Description:N-Acetyl-L-tyrosine is a derivative of the amino acid L-tyrosine, characterized by the addition of an acetyl group to the nitrogen atom of the amino group. This modification enhances its solubility in water and stability compared to L-tyrosine. It is a white to off-white crystalline powder, typically odorless, and is soluble in water and alcohol. N-Acetyl-L-tyrosine is often used as a dietary supplement, particularly for its potential cognitive and neuroprotective benefits, as it may support the synthesis of neurotransmitters such as dopamine. Additionally, it is utilized in various biochemical and pharmaceutical applications due to its role in protein synthesis and as a precursor in the production of melanin. The compound is generally regarded as safe when used appropriately, but like any supplement, it should be taken with caution and under guidance, especially in individuals with specific health conditions or those taking certain medications. Its CAS number, 537-55-3, is a unique identifier that facilitates its recognition in chemical databases and regulatory frameworks.
Formula:C11H13NO4
InChI:InChI=1S/C11H13NO4/c1-7(13)12-10(11(15)16)6-8-2-4-9(14)5-3-8/h2-5,10,14H,6H2,1H3,(H,12,13)(H,15,16)/t10-/m0/s1
InChI key:InChIKey=CAHKINHBCWCHCF-JTQLQIEISA-N
SMILES:O=C(O)C(NC(=O)C)CC1=CC=C(O)C=C1
- Synonyms:
- (+)-(2S)-2-(Acetylamino)-3-(4-hydroxyphenyl)propanoic acid
- (2S)-2-(Acetylamino)-3-(4-Hydroxyphenyl)Propanoate
- (2S)-2-Acetamido-3-(4-hydroxyphenyl)propanoic acid
- <span class="text-smallcaps">L</span>-N-Acetyltyrosine
- <span class="text-smallcaps">L</span>-Tyrosine, N-acetyl-
- Ac-Tyr-Oh
- Ac-Tyrosine
- Acetyl-L-Tyrosine
- Acetyltyrosine
- L-Tyrosine, N-Acetyl-
- See more synonyms
- N-Ac-L-Tyr
- N-Acetyl-<span class="text-smallcaps">L</span>-tyrosine
- N-Acetyl-L-tryosine
- N-Acetyltyrosine
- N-Aceyl-L-Tyrosine
- NSC 10853
- Tyr-Excel
- Tyrosine, N-acetyl-, <span class="text-smallcaps">L</span>-
- N-Acetyl-L-tyrosine
- L-N-Acetyltyrosine
- Tyrosine, N-acetyl-, L-
