CAS 5371-70-0
:dimethyl 4-chloropyridine-2,6-dicarboxylate
Description:
Dimethyl 4-chloropyridine-2,6-dicarboxylate is an organic compound characterized by its pyridine ring structure substituted with two carboxylate groups and a chlorine atom. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic nature. The presence of the chlorine atom and the two ester functional groups contributes to its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The compound may exhibit moderate toxicity, and appropriate safety measures should be taken when handling it. Its molecular structure allows for potential applications in medicinal chemistry, where it can serve as a building block for more complex molecules. As with many chemical substances, proper storage and handling protocols are essential to ensure safety and stability.
Formula:C9H8ClNO4
InChI:InChI=1/C9H8ClNO4/c1-14-8(12)6-3-5(10)4-7(11-6)9(13)15-2/h3-4H,1-2H3
SMILES:COC(=O)c1cc(cc(C(=O)OC)n1)Cl
Synonyms:- 2,6-Pyridinedicarboxylic Acid, 4-Chloro-, Dimethyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Dimethyl 4-Chloro-2,6-pyridinedicarboxylate
CAS:Formula:C9H8ClNO4Purity:>98.0%(GC)(N)Color and Shape:White to Light yellow powder to crystalMolecular weight:229.62Dimethyl 4-chloropyridine-2,6-dicarboxylate, 97%
CAS:Employed as an important intermediate for raw material for organic synthesis, agrochemical, pharmaceutical and dyestuff field This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brandFormula:C9H8ClNO4Purity:97%Molecular weight:229.62Dimethyl 4-chloropyridine-2,6-dicarboxylate
CAS:Dimethyl 4-chloropyridine-2,6-dicarboxylateFormula:C9H8ClNO4Purity:98%Molecular weight:229.62dimethyl 4-chloropyridine-2,6-dicarboxylate
CAS:Formula:C9H8ClNO4Purity:98%Color and Shape:SolidMolecular weight:229.6171Ref: IN-DA00DBJZ
1kgTo inquire500gTo inquire250mg21.00€1g25.00€5g53.00€10g65.00€25g116.00€100g257.00€Dimethyl 4-chloropyridine-2,6-dicarboxylate
CAS:Dimethyl 4-chloropyridine-2,6-dicarboxylateFormula:C9H8ClNO4Purity:98%Color and Shape:SolidMolecular weight:229.619Dimethyl 4-chloropyridine-2,6-dicarboxylate
CAS:Dimethyl 4-chloropyridine-2,6-dicarboxylate is a Heterocyclic compound-pyridine, intermediate and building block-electrophile.Formula:C9H8ClNO4Color and Shape:SolidMolecular weight:229.62Ref: TM-TNU0660
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquireDimethyl 4-chloropyridine-2,6-dicarboxylate
CAS:Formula:C9H8ClNO4Purity:95%Color and Shape:Solid, Off-white powderMolecular weight:229.62






