CAS 53716-49-7: Carprofen
Description:Carprofen is a non-steroidal anti-inflammatory drug (NSAID) primarily used in veterinary medicine for the relief of pain and inflammation in animals, particularly dogs. It belongs to the propionic acid class of NSAIDs and is structurally related to ibuprofen. Carprofen exhibits analgesic, anti-inflammatory, and antipyretic properties, making it effective for managing conditions such as osteoarthritis and postoperative pain. The mechanism of action involves the inhibition of cyclooxygenase (COX) enzymes, which play a crucial role in the synthesis of prostaglandins, mediators of inflammation and pain. Carprofen is typically administered orally or via injection, and its pharmacokinetics indicate a relatively long half-life, allowing for once or twice daily dosing. While generally well-tolerated, potential side effects may include gastrointestinal upset, liver enzyme elevation, and renal impairment, necessitating monitoring during treatment. As with all medications, it is essential to use Carprofen under veterinary guidance to ensure safety and efficacy for the specific animal being treated.
Formula:C15H12ClNO2
InChI:InChI=1S/C15H12ClNO2/c1-8(15(18)19)9-2-4-11-12-7-10(16)3-5-13(12)17-14(11)6-9/h2-8,17H,1H3,(H,18,19)
InChI key:InChIKey=PUXBGTOOZJQSKH-UHFFFAOYSA-N
SMILES:O=C(O)C(C=1C=CC2=C(C1)NC3=CC=C(Cl)C=C32)C
- Synonyms:
- (+/-)-6-Chloro-Alpha-Methylcarbazole-2-Acetic Acid
- (dl)-6-Chloro-α-methylcarbazole-2-acetic acid
- 2-(6-Chlorocarbazol-2-yl)propionic acid
- 2-(6-chloro-9H-carbazol-2-yl)propanoic acid
- 6-Chloro-Alpha-Methyl-9H-Carbazole-2-Acetic Acid
- 6-Chloro-α-methyl-9H-carbazole-2-acetic acid
- 6-Chloro-α-methylcarbazole-2-acetic acid
- 9H-Carbazole-2-acetic acid, 6-chloro-α-methyl-
- C 5720
- Carprodyl
- See more synonyms
- Carprofene
- Carprofeno
- Imadyl
- Nsc 297935
- Rimadyl
- Ro 20-5720
- Ro 20-5720/000
- Vetprofen
