CAS 53723-88-9
:(5-Mercapto-1,3,4-thiadiazole-2-ylthio)acetic acid
Description:
(5-Mercapto-1,3,4-thiadiazole-2-ylthio)acetic acid, with the CAS number 53723-88-9, is a chemical compound characterized by the presence of a thiadiazole ring, which contributes to its unique properties. This compound features a mercapto group (-SH) and a thioether linkage, enhancing its reactivity and potential for forming metal complexes. It is typically a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid functional group (-COOH). The thiol group imparts reducing properties, making it useful in various chemical reactions, including those involving metal ions. Additionally, this compound may exhibit biological activity, potentially serving as a ligand in coordination chemistry or as an agent in medicinal chemistry. Its structural characteristics suggest potential applications in fields such as agriculture, pharmaceuticals, and materials science, particularly in the development of new compounds with specific biological or chemical functions. However, handling precautions should be observed due to the reactivity of thiol groups.
Formula:C4H4N2O2S3
InChI:InChI=1/C4H4N2O2S3/c7-2(8)1-10-4-6-5-3(9)11-4/h1H2,(H,5,9)(H,7,8)
InChI key:InChIKey=UJBXVTJYSIDCIE-UHFFFAOYSA-N
SMILES:S(CC(O)=O)C=1SC(=S)NN1
Synonyms:- (5-Mercapto-1,3,4-thiadiazole-2-ylthio)aceticacid
- 2-Carboxymethylmercapto-5-mercapto-1,3,4-thiadiazole
- 2-Carboxymethylthio-5-mercapto-1,3,4-thiadiazole
- 2-Carboxythio-5-mercapto-1,3,4-thiadiazole
- 2-[(2-Sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetic acid
- 2-[(4,5-Dihydro-5-thioxo-1,3,4-thiadiazol-2-yl)thio]acetic acid
- 2-[(5-Mercapto-1,3,4-thiadiazol-2-yl)thio]acetic acid
- 2-[(5-Sulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetic acid
- Acetic acid, (5-mercapto-1,3,4-thiadiazol-2-ylthio)-
- Acetic acid, 2-[(4,5-dihydro-5-thioxo-1,3,4-thiadiazol-2-yl)thio]-
- Acetic acid, [(4,5-dihydro-5-thioxo-1,3,4-thiadiazol-2-yl)thio]-
- NSC 12586
- [(5-Mercapto-1,3,4-thiadiazol-2-yl)thio]acetic acid
- [(5-Thioxo-4,5-Dihydro-1,3,4-Thiadiazol-2-Yl)Sulfanyl]Acetate
- [(5-Thioxo-4,5-Dihydro-1,3,4-Thiadiazol-2-Yl)Sulfanyl]Acetic Acid
- [(4,5-dihydro-5-thioxo-1,3,4-thiadiazol-2-yl)thio]-aceticaci
- 2-[(5-Thio-1,3,4-thiadiazol-2-yl)thio]acetic acid
- 5-Mercapto-1,3,4-thiadiazole-2-thioacetic acid
- [(5-SULFANYL-1,3,4-THIADIAZOL-2-YL)SULFANYL]ACETIC ACID
- (5-MERCAPTO-1,3,4-THIADIAZOL-2-YLTHIO)ACETIC ACID
- [(4,5-dihydro-5-thioxo-1,3,4-thiadiazol-2-yl)thio]acetic acid
- 2-[(5-Mercapto-1,3,4-thiadiazol-2-yl)thio]acetic acid, 95+%
- 2-[(5-Thio-1,3,4-thiadiazol-2-yl)thio]acetic acid 95%
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
[(5-Sulphanyl-1,3,4-thiadiazol-2-yl)sulphanyl]acetic acid
CAS:[(5-Sulphanyl-1,3,4-thiadiazol-2-yl)sulphanyl]acetic acidFormula:C4H4N2O2S3Purity:97%Color and Shape:SolidMolecular weight:208.28176(5-Mercapto-1,3,4-thiadiazol-2-ylthio)acetic acid
CAS:Formula:C4H4N2O2S3Purity:98%Color and Shape:SolidMolecular weight:208.2818(5-Mercapto-1,3,4-thiadiazol-2-ylthio)acetic Acid
CAS:Formula:C4H4N2O2S3Purity:>97.0%(T)(HPLC)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:208.275-Mercapto-1,3,4-thiadiazol-2-ylthioacetic acid
CAS:Formula:C4H4N2O2S3Purity:98%Color and Shape:SolidMolecular weight:208.272-[(5-Mercapto-1,3,4-thiadiazol-2-yl)thio]acetic acid
CAS:2-[(5-Mercapto-1,3,4-thiadiazol-2-yl)thio]acetic acid (MTTSA) is a fluorescent probe that emits light at a wavelength of 590 nm when irradiated with light. MTTSA has been synthesized using gold nanoclusters as the catalyst. The average diameter of the nanoclusters was determined to be in the range of 2.0 - 3.0 nm, and their average quantum yield was found to be 0.097%. The emission wavelengths can be tuned by varying the size of the nanoclusters. When MTTSA is irradiated with UV radiation, it undergoes photocatalysis and converts organic matter into water and carbon dioxide gas.Formula:C4H4N2O2S3Purity:Min. 95%Molecular weight:208.29 g/mol




