CymitQuimica logo

CAS 5381-25-9

:

1-benzothiophene-3-carboxylic acid

Description:
1-Benzothiophene-3-carboxylic acid is an organic compound characterized by its fused benzene and thiophene rings, which contribute to its aromatic properties. This compound features a carboxylic acid functional group (-COOH) at the 3-position of the benzothiophene structure, influencing its reactivity and solubility. It typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in pharmaceuticals and as a building block for more complex molecules. Its unique structure allows for various chemical modifications, making it a versatile intermediate in synthetic chemistry. Additionally, the presence of sulfur in the thiophene ring can impart distinct electronic properties, which may enhance its utility in electronic applications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H6O2S
InChI:InChI=1/C9H6O2S/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5H,(H,10,11)
InChI key:DRBLTQNCQJXSNU-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c(cs2)C(=O)O
Synonyms:
  • Benzothiophene-3-carboxylic acid
Found 6 products.