CAS 5381-25-9
:1-benzothiophene-3-carboxylic acid
Description:
1-Benzothiophene-3-carboxylic acid is an organic compound characterized by its fused benzene and thiophene rings, which contribute to its aromatic properties. This compound features a carboxylic acid functional group (-COOH) at the 3-position of the benzothiophene structure, influencing its reactivity and solubility. It typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in pharmaceuticals and as a building block for more complex molecules. Its unique structure allows for various chemical modifications, making it a versatile intermediate in synthetic chemistry. Additionally, the presence of sulfur in the thiophene ring can impart distinct electronic properties, which may enhance its utility in electronic applications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H6O2S
InChI:InChI=1/C9H6O2S/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5H,(H,10,11)
SMILES:c1ccc2c(c1)c(cs2)C(=O)O
Synonyms:- Benzothiophene-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzo[b]thiophene-3-carboxylic Acid
CAS:Formula:C9H6O2SPurity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:178.21Benzo[b]thiophene-3-carboxylic acid, 96%
CAS:Benzo[b]thiophene-3-carboxylic acid is used as organic chemical synthesis intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / itFormula:C9H6O2SPurity:96%Color and Shape:Light yellow, PowderMolecular weight:178.21Benzo[b]thiophene-3-carboxylic acid
CAS:Benzo[b]thiophene-3-carboxylic acidFormula:C9H6O2SPurity:≥95%Color and Shape:SolidMolecular weight:178.207731-Benzothiophene-3-carboxylic acid
CAS:Formula:C9H6O2SPurity:95%Color and Shape:SolidMolecular weight:178.2077Benzo[b]thiophene-3-carboxylic acid
CAS:Formula:C9H6O2SPurity:96%Color and Shape:SolidMolecular weight:178.21




