CAS 53826-12-3
:Octanoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-
Description:
Octanoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro- is a perfluorinated fatty acid characterized by a long carbon chain with multiple fluorine substitutions. This compound features a total of 13 carbon atoms, with the octanoic acid backbone modified by the presence of fluorine atoms at specific positions, which significantly alters its chemical properties. The fluorination enhances the hydrophobicity and lipophobicity of the molecule, making it less soluble in water while increasing its stability against oxidation and degradation. This compound is likely to exhibit unique surface-active properties, making it of interest in various applications, including surfactants and emulsifiers. Additionally, the presence of fluorine can impart specific biological interactions, which may be relevant in studies of environmental persistence and toxicity. Overall, the characteristics of this substance make it a subject of interest in both industrial applications and environmental chemistry.
Formula:C8H3F13O2
InChI:InChI=1S/C8H3F13O2/c9-3(10,1-2(22)23)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1H2,(H,22,23)
InChI key:LRWIIEJPCFNNCZ-UHFFFAOYSA-N
SMILES:C(C(=O)O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanoic acid
CAS:3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanoic acidFormula:C8H3F13O2Purity:≥95%Color and Shape:White SolidMolecular weight:378.08746(Perfluorohexyl)acetic Acid
CAS:Applications (Perfluorohexyl)acetic Acid is a pollutant, present in solid waste from consumer products such as pizza boxes and teflon.
References Allred, B. M. et al.: Env. Sci. Tech., 49, 7648 (2015); Washington, J. et al.: Env. Sci. Tech., 49, 915 (2015);Formula:C8H3F13O2Color and Shape:NeatMolecular weight:378.09(Perfluorohexyl)acetic acid
CAS:Perfluorohexyl acetic acid is a hydrophobic, organic solvent that has been shown to desorb polyfluoroalkyl compounds from the surface of organisms and invertebrates. It has been used as a reaction medium for the synthesis of fatty acids and chloride derivatives. Perfluorohexyl acetic acid is also an effective desorption agent in the removal of polyfluoroalkyl substances from contaminated soils and sediments.
Formula:C8H3F13O2Purity:Min. 95%Color and Shape:PowderMolecular weight:378.09 g/mol






