CAS 53861-35-1
:Cascaroside D
Description:
Cascaroside D is a natural glycoside derived from the bark of the Cascara sagrada tree (Rhamnus purshiana), commonly used for its laxative properties. It belongs to a class of compounds known as anthraquinone glycosides, which are characterized by their sugar moiety attached to an anthraquinone structure. Cascaroside D exhibits a yellowish to brown color and is typically soluble in water and alcohol, making it suitable for extraction and formulation in various herbal remedies. Its mechanism of action primarily involves stimulating intestinal motility and increasing water content in the intestines, which aids in alleviating constipation. Additionally, Cascaroside D may possess antioxidant properties, contributing to its potential health benefits. However, it is essential to use this compound with caution, as excessive consumption can lead to adverse effects such as abdominal cramps and diarrhea. As with any herbal supplement, it is advisable to consult healthcare professionals before use, especially for individuals with underlying health conditions or those taking other medications.
Formula:C27H32O13
InChI:InChI=1S/C27H32O13/c1-9-5-11-16(26-24(36)22(34)19(31)14(7-28)38-26)10-3-2-4-13(18(10)21(33)17(11)12(30)6-9)39-27-25(37)23(35)20(32)15(8-29)40-27/h2-6,14-16,19-20,22-32,34-37H,7-8H2,1H3
InChI key:InChIKey=GQPFUOPPYJYZHE-UHFFFAOYSA-N
SMILES:OC1C(C2C=3C(=C(OC4OC(CO)C(O)C(O)C4O)C=CC3)C(=O)C=5C2=CC(C)=CC5O)OC(CO)C(O)C1O
Synonyms:- Cascaroside D
- 9(10H)-Anthracenone, 10-β-D-glucopyranosyl-8-(β-D-glucopyranosyloxy)-1-hydroxy-3-methyl-
- 10-β-D-Glucopyranosyl-8-(β-D-glucopyranosyloxy)-1-hydroxy-3-methyl-9(10H)-anthracenone
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Cascaroside D
CAS:Cascaroside D is a naturally occurring anthraquinone glycoside, which is extracted from the bark of cascara sagrada (Rhamnus purshiana). It functions primarily as a stimulant laxative, which acts on the smooth muscle of the colon. The mode of action involves the hydrolysis of cascarosides in the intestines, subsequently activating peristalsis and increasing water and electrolyte secretion in the large intestine.
Formula:C27H32O13Purity:Min. 95%Molecular weight:564.54 g/molRef: 4Z-C-378004
Discontinued product

