CymitQuimica logo

CAS 5394-36-5

:

5-Ethyl-5-methylhydantoin

Description:
5-Ethyl-5-methylhydantoin is an organic compound characterized by its hydantoin structure, which features a five-membered ring containing two carbonyl groups and two nitrogen atoms. This compound is typically a white to off-white crystalline solid, exhibiting good solubility in polar solvents such as water and alcohols. It is known for its stability under normal conditions and can be synthesized through various methods involving the reaction of appropriate amines and carbonyl compounds. 5-Ethyl-5-methylhydantoin has potential applications in pharmaceuticals and agrochemicals, primarily due to its ability to act as a building block in the synthesis of more complex molecules. Additionally, it may exhibit biological activity, although specific pharmacological properties would require further investigation. Safety data indicates that, like many organic compounds, it should be handled with care, avoiding inhalation and skin contact. Overall, 5-Ethyl-5-methylhydantoin represents a versatile compound in organic synthesis with potential utility in various chemical applications.
Formula:C6H10N2O2
InChI:InChI=1S/C6H10N2O2/c1-3-6(2)4(9)7-5(10)8-6/h3H2,1-2H3,(H2,7,8,9,10)
InChI key:InChIKey=VSJRBQDMBFFHMC-UHFFFAOYSA-N
SMILES:C(C)C1(C)C(=O)NC(=O)N1
Synonyms:
  • 2,4-Imidazolidinedione, 5-ethyl-5-methyl-
  • 5-Ethyl-5-Methylhydantoin
  • 5-Ethyl-5-Methylimidazolidine-2,4-Dione
  • 5-Ethyl-5-methyl-2,4-imidazolidinedione
  • Hydantoin, 5-ethyl-5-methyl-
  • Methylethylhydantoin
  • NSC 1020
Found 4 products.