CAS 53981-24-1: 2-Amino-5-fluorophenol
Description:2-Amino-5-fluorophenol is an organic compound characterized by the presence of an amino group (-NH2) and a fluorine atom attached to a phenolic ring. Its molecular formula is C6H6FNO, indicating it contains six carbon atoms, six hydrogen atoms, one nitrogen atom, and one fluorine atom. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and as an intermediate in organic synthesis. The amino group contributes to its basicity, while the fluorine atom can influence its reactivity and solubility in various solvents. 2-Amino-5-fluorophenol may exhibit properties such as being a weak acid due to the phenolic hydroxyl group, and it can participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic reactions. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks upon exposure. Proper safety measures, including the use of personal protective equipment, are recommended when working with this compound.
Formula:C9H8F3NO2
InChI:InChI=1/C9H8F3NO2/c10-9(11,12)7-3-1-6(5-13-7)2-4-8(14)15/h1,3,5H,2,4H2,(H,14,15)
InChI key:InChIKey=IIDUNAVOCYMUFB-UHFFFAOYSA-N
SMILES:FC1=CC=C(N)C(O)=C1
- Synonyms:
- (4-Fluoro-2-hydroxyphenyl)amine
- 3-[6-(Trifluoromethyl)Pyridin-3-Yl]Propanoic Acid
- 4-Fluoro-2-hydroxyaniline
- 5-Fluoro-2-aminophenol
- Phenol, 2-amino-5-fluoro-
