CAS 5399-87-1: 6-Chloropurine riboside
Description:6-Chloropurine riboside is a nucleoside analog characterized by the presence of a purine base, specifically chloropurine, linked to a ribose sugar. This compound features a chlorine atom at the 6-position of the purine ring, which influences its biological activity and interaction with nucleic acid synthesis. It is typically used in research and pharmaceutical applications, particularly in the study of antiviral and anticancer properties due to its ability to interfere with nucleic acid metabolism. The riboside structure allows it to be incorporated into RNA, potentially disrupting normal cellular processes. 6-Chloropurine riboside is soluble in water and exhibits moderate stability under physiological conditions, although it may be subject to enzymatic degradation. Its mechanism of action often involves the inhibition of enzymes involved in nucleotide synthesis, making it a valuable tool in the development of therapeutic agents targeting viral infections and malignancies. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity.
Formula:C10H11ClN4O4
InChI:InChI=1S/C10H11ClN4O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2/t4-,6-,7-,10-/m1/s1
InChI key:InChIKey=XHRJGHCQQPETRH-KQYNXXCUSA-N
SMILES:ClC1=NC=NC2=C1N=CN2C3OC(CO)C(O)C3O
- Synonyms:
- 6-Chloro-6-deaminoadenosine
- 6-Chloro-9-β-<span class="text-smallcaps">D</span>-ribofuranosyl-9H-purine
- 6-Chloro-9-β-<span class="text-smallcaps">D</span>-ribofuranosylpurine
- 6-Chloronebularine
- 6-Chloropurine 9-β-<span class="text-smallcaps">D</span>-ribofuranoside
- 6-Chloropurine nucleoside
- 6-Chloropurine ribose
- 6-Chloropurine-9-¤-D-ribofuranoside
- 6-Chloropurine-<span class="text-smallcaps">D</span>-riboside
- 6-Chloropurinosine
- See more synonyms
- 6-chloro-9-(beta-D-ribofuranosyl)-9H-purine
- 6-chloro-9-alpha-L-lyxofuranosyl-9H-purine
- 6-chloro-9-pentofuranosyl-9H-purine
- 9-(β-<span class="text-smallcaps">D</span>-Ribofuranosyl)-6-chloropurine
- 9H-Purine, 6-chloro-9-β-<span class="text-smallcaps">D</span>-ribofuranosyl-
- NSC 4910
- 6-Chloropurine riboside
- 6-Chloro-9-β-D-ribofuranosyl-9H-purine
- 9H-Purine, 6-chloro-9-β-D-ribofuranosyl-
- 6-Chloro-9-β-D-ribofuranosylpurine