CymitQuimica logo

CAS 541539-87-1

:

6-Chloro-2-methyl-2H-indazole

Description:
6-Chloro-2-methyl-2H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 6-position and a methyl group at the 2-position contributes to its unique properties. This compound is typically classified as a heterocyclic aromatic compound due to the nitrogen atoms in its structure. It is often studied for its potential biological activities, including its role in medicinal chemistry and drug development. The compound may exhibit various physical properties such as solubility in organic solvents and stability under specific conditions, which are important for its application in research and industry. Additionally, its molecular structure allows for potential interactions with biological targets, making it of interest in pharmacological studies. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C8H7ClN2
InChI:InChI=1S/C8H7ClN2/c1-11-5-6-2-3-7(9)4-8(6)10-11/h2-5H,1H3
InChI key:InChIKey=VMLMCURMWQPXSP-UHFFFAOYSA-N
SMILES:CN1C=C2C(=N1)C=C(Cl)C=C2
Synonyms:
  • 2H-indazole, 6-chloro-2-methyl-
  • 6-Chloro-2-methyl-2H-indazole
  • 6-Chloro-2-methyl-2H-indazole
Found 4 products.