CAS 5423-98-3
:5-(bromomethyl)-2-methylpyrimidin-4-amine
Description:
5-(Bromomethyl)-2-methylpyrimidin-4-amine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromomethyl group at the 5-position and an amino group at the 4-position contributes to its reactivity and potential applications in medicinal chemistry and organic synthesis. The methyl group at the 2-position enhances the compound's lipophilicity, which may influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its reactivity is largely attributed to the bromomethyl group, which can participate in nucleophilic substitution reactions, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the presence of the amino group allows for further functionalization, potentially leading to derivatives with enhanced pharmacological properties. As with many brominated compounds, appropriate safety measures should be taken during handling due to the potential for toxicity and environmental impact.
Formula:C6H8BrN3
InChI:InChI=1/C6H8BrN3/c1-4-9-3-5(2-7)6(8)10-4/h3H,2H2,1H3,(H2,8,9,10)
SMILES:Cc1ncc(CBr)c(=N)[nH]1
Synonyms:- 4-Amino-5-bromomethyl-2-methylpyrimidine
- 4-Pyrimidinamine, 5-(Bromomethyl)-2-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N-((2,3-Dihydrobenzo[b][1,4]dioxin-2-yl)methyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine
CAS:Formula:C6H10Br3N3Color and Shape:SolidMolecular weight:363.8757GRK-IN-1
CAS:4-Amino-5-(bromomethyl)-2-methylpyrimidine used in vitamin B1 analogs and esters synthesis.Formula:C6H10Br3N3Color and Shape:SolidMolecular weight:363.8794-Amino-5-(bromomethyl)-2-methylpyrimidine Dihydrobromide
CAS:Controlled ProductApplications A pyrimidine derivative as G protein-coupled receptor kinase (GRK) inhibitor.
References Bigham, E., et al.: J. Med. Chem., 35, 1399 (1992), Jansen, M., et al.: Biochem. Pharmacol., 47, 1067 (1994), Hasbi, A., et al.: J. Neurochem., 70, 2129 (1998),Formula:C17H17N3O2SColor and Shape:NeatMolecular weight:327.4


