CAS 5423-98-3

5-(bromomethyl)-2-methylpyrimidin-4-amine

Description:

5-(Bromomethyl)-2-methylpyrimidin-4-amine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromomethyl group at the 5-position and an amino group at the 4-position contributes to its reactivity and potential applications in medicinal chemistry and organic synthesis. The methyl group at the 2-position enhances the compound's lipophilicity, which may influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its reactivity is largely attributed to the bromomethyl group, which can participate in nucleophilic substitution reactions, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the presence of the amino group allows for further functionalization, potentially leading to derivatives with enhanced pharmacological properties. As with many brominated compounds, appropriate safety measures should be taken during handling due to the potential for toxicity and environmental impact.

Formula: C₆H₈BrN₃

InChI: InChI=1/C6H8BrN3/c1-4-9-3-5(2-7)6(8)10-4/h3H,2H2,1H3,(H2,8,9,10)

SMILES: Cc1ncc(CBr)c(=N)[nH]1

Synonyms:

• 4-Amino-5-bromomethyl-2-methylpyrimidine
• 4-Pyrimidinamine, 5-(Bromomethyl)-2-Methyl-

N-((2,3-Dihydrobenzo[b][1,4]dioxin-2-yl)methyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine

CAS: 5423-98-3

Formula: C₆H₁₀Br₃N₃

Color and Shape: Solid

Molecular weight: 363.8757

Ref: IN-DA00DF9B

GRK-IN-1

CAS: 5423-98-3

4-Amino-5-(bromomethyl)-2-methylpyrimidine used in vitamin B1 analogs and esters synthesis.

Formula: C₆H₁₀Br₃N₃

Color and Shape: Solid

Molecular weight: 363.879

Ref: TM-T35723

4-Amino-5-(bromomethyl)-2-methylpyrimidine Dihydrobromide

Controlled Product

CAS: 5423-98-3

Applications A pyrimidine derivative as G protein-coupled receptor kinase (GRK) inhibitor.
References Bigham, E., et al.: J. Med. Chem., 35, 1399 (1992), Jansen, M., et al.: Biochem. Pharmacol., 47, 1067 (1994), Hasbi, A., et al.: J. Neurochem., 70, 2129 (1998),

Formula: C₁₇H₁₇N₃O₂S

Color and Shape: Neat

Molecular weight: 327.40

Ref: TR-A601820