CAS 54240-36-7
:Benzenemethanol, 4-amino-3-chloro-α-[[(1,1-dimethylethyl)amino]methyl]-5-(trifluoromethyl)-, hydrochloride (1:1)
Description:
Benzenemethanol, 4-amino-3-chloro-α-[[(1,1-dimethylethyl)amino]methyl]-5-(trifluoromethyl)-, hydrochloride (1:1), commonly referred to by its CAS number 54240-36-7, is a chemical compound characterized by its complex structure that includes a benzene ring substituted with various functional groups. The presence of an amino group and a chloro substituent indicates potential reactivity and biological activity, while the trifluoromethyl group enhances lipophilicity and may influence pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in pharmaceutical formulations. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions of use and the presence of other solvents or reagents. Overall, this compound's unique functional groups suggest potential applications in various chemical and biological contexts, warranting further investigation into its properties and uses.
Formula:C13H18ClF3N2O·ClH
InChI:InChI=1S/C13H18ClF3N2O.ClH/c1-12(2,3)19-6-10(20)7-4-8(13(15,16)17)11(18)9(14)5-7;/h4-5,10,19-20H,6,18H2,1-3H3;1H
InChI key:InChIKey=MMCDXJOMPMIKGP-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(C(CNC(C)(C)C)O)=CC(Cl)=C1N.Cl
Synonyms:- 1-[4-Amino-3-chloro-5-(trifluoromethyl)phenyl]-2-(tert-butylamino)ethanol hydrochloride
- Benzenemethanol, 4-amino-3-chloro-α-[[(1,1-dimethylethyl)amino]methyl]-5-(trifluoromethyl)-, hydrochloride (1:1)
- Benzenemethanol, 4-amino-3-chloro-α-[[(1,1-dimethylethyl)amino]methyl]-5-(trifluoromethyl)-, monohydrochloride
- Broncholin
- KF 868 (pharmaceutical)
- Kf 868
- N-{2-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-hydroxyethyl}-2-methylpropan-2-aminium chloride
- dl-Mabuterol hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Mabuterolhydrochloride
CAS:Formula:C13H19Cl2F3N2OPurity:95%Color and Shape:SolidMolecular weight:347.2040Mabuterol hydrochloride
CAS:Formula:C13H19Cl2F3N2OPurity:≥ 95.0%Color and Shape:White to off-white powderMolecular weight:347.20Mabuterol hydrochloride (Standard)
CAS:Mabuterol hydrochloride (Standard) is the standard substance of Mabuterol hydrochloride, and it is applicable for quantitative analysis, quality control, and related research in biochemical experiments. Mabuterol hydrochloride is a selective β2 adrenoreceptor agonist. Mabuterol has a specific effect on beta 2-adrenoceptors with no beta 1-stimulation.Formula:C13H19Cl2F3N2OMolecular weight:347.20Mabuterol Hydrochloride
CAS:Controlled ProductFormula:C13H18ClF3N2O·ClHColor and Shape:NeatMolecular weight:347.2Mabuterol hydrochloride
CAS:β2 adrenoreceptor agonistFormula:C13H18ClF3N2O·HClPurity:Min. 95%Color and Shape:White PowderMolecular weight:347.2 g/molMabuterol hydrochloride
CAS:Mabuterol hydrochloride is a selective β2 adrenoreceptor agonist. Mabuterol has a specific effect on beta 2-adrenoceptors with no beta 1-stimulation.Formula:C13H19Cl2F3N2OColor and Shape:SolidMolecular weight:347.20







