CAS 5426-09-5
:3a,4,7,7a-Tetrahydro-4,7-epoxyisobenzofuran-1,3-dione
Description:
3a,4,7,7a-Tetrahydro-4,7-epoxyisobenzofuran-1,3-dione, with the CAS number 5426-09-5, is a chemical compound characterized by its unique bicyclic structure that includes a furan ring and an epoxy group. This compound is part of the class of isobenzofurans, which are known for their diverse biological activities and potential applications in medicinal chemistry. The presence of the dione functional groups indicates that it can participate in various chemical reactions, such as nucleophilic additions or cycloadditions. Its tetrahydro configuration suggests that it is a saturated derivative, which may influence its reactivity and stability. The compound's epoxy group can also contribute to its reactivity, making it a potential candidate for further chemical modifications. While specific physical properties such as melting point, boiling point, and solubility are not provided here, compounds of this nature typically exhibit moderate polarity and may be soluble in organic solvents. Overall, 3a,4,7,7a-Tetrahydro-4,7-epoxyisobenzofuran-1,3-dione is of interest for its structural features and potential applications in organic synthesis and pharmaceuticals.
Formula:C8H6O4
InChI:InChI=1S/C8H6O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h1-6H
InChI key:InChIKey=QQYNRBAAQFZCLF-UHFFFAOYSA-N
SMILES:O=C1C2C(C3OC2C=C3)C(=O)O1
Synonyms:- 1,4-Epoxycyclohex-5-ene-2,3-dicarboxylic anhydride
- 3,6-Endoxo-delta'-tetrahydrophthalic anhydride
- 3,6-Epoxy-1,2,3,6-tetrahydrophthalic anhydride
- 3A,4,7,7A-Tetrahydro-4,7-Epoxy-2-Benzofuran-1,3-Dione
- 4,10-Dioxatricyclo[5.2.1.0<sup>2,6</sup>]dec-8-ene-3,5-dion
- 4,10-Dioxatricyclo[5.2.1.0<sup>2,6</sup>]dec-8-ene-3,5-dione
- 4,7-Epoxyisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro-
- 7-Oxabicyclo(2.2.1)-5-heptene-2,3-dicarboxylic anhydride
- 7-Oxabicyclo(2.2.1)hept-5-ene-2,3-dicarboxylic anhydride
- 7-Oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid anhydride
- Furan-maleic anhydride Diels-Alder adduct
- Furan-maleic anhydride adduct
- Furan-maleic anhydride copolymer
- Nsc 14002
- Nsc 231495
- Nsc 61997
- 3a,4,7,7a-Tetrahydro-4,7-epoxyisobenzofuran-1,3-dione
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,10-dioxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione
CAS:4,10-dioxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dioneFormula:C8H6O4Purity:95%Molecular weight:166.130844,10-DIOXATRICYCLO[5.2.1.0(2,6)]DEC-8-ENE-3,5-DIONE
CAS:Formula:C8H6O4Purity:97%Color and Shape:SolidMolecular weight:166.13084,10-dioxatricyclo[5.2. 1.02.6]dec-8-ene-3,5-dione
CAS:Intermediate and building block -anhydrideFormula:C8H6O4Color and Shape:SolidMolecular weight:166.13Ref: TM-TNU0618
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire4,10-Dioxatricyclo[5.2.1.02.6]dec-8-ene-3,5-dione
CAS:4,10-Dioxatricyclo[5.2.1.02.6]dec-8-ene-3,5-dione (DTDE) is a hypoglycemic agent that inhibits the synthesis of fatty acids in the liver and reduces blood sugar levels by inhibiting the enzyme diacylglycerol acyltransferase 2 (DGAT2). DTDE has been shown to have antitumour activity against a human cell line and inhibits the replication of DNA and RNA by binding to amines in nucleic acid bases.Formula:C8H6O4Purity:Min. 95%Molecular weight:166.13 g/mol




