CAS 5427-26-9
:5-Hydantoinacetic acid
Description:
5-Hydantoinacetic acid, with the CAS number 5427-26-9, is an organic compound characterized by its hydantoin structure, which features a five-membered ring containing nitrogen and carbon atoms. This compound is a derivative of hydantoin and possesses both carboxylic acid and amine functional groups, contributing to its potential as a versatile building block in organic synthesis. It is typically a white to off-white crystalline solid, soluble in water and polar organic solvents, which enhances its utility in various chemical reactions. The presence of the carboxylic acid group allows for acid-base reactions, while the hydantoin moiety can participate in cyclization and other transformations. 5-Hydantoinacetic acid has applications in pharmaceuticals and agrochemicals, particularly in the development of bioactive compounds. Its stability and reactivity make it an interesting subject for research in medicinal chemistry and materials science. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C5H6N2O4
InChI:InChI=1S/C5H6N2O4/c8-3(9)1-2-4(10)7-5(11)6-2/h2H,1H2,(H,8,9)(H2,6,7,10,11)
InChI key:InChIKey=DQQLZADYSWBCOX-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1NC(=O)NC1=O
Synonyms:- (2,5-Dioxoimidazolidin-4-Yl)Acetic Acid
- 2,4-Dioxoimidazolidine-5-acetic acid
- 2,5-Dioxo-4-imidazolidineacetic acid
- 2-(2,5-Dioxoimidazolidin-4-yl)acetic acid
- 4-Imidazolidineacetic acid, 2,5-dioxo-
- 5-(Carboxymethyl)hydantoin
- 5-Hydantoinacetic acid
- <span class="text-smallcaps">DL</span>-5-(Carboxymethyl)hydantoin
- NSC 14985
- NSC 49347
- [(4R)-2,5-dioxoimidazolidin-4-yl]acetate
- [(4S)-2,5-dioxoimidazolidin-4-yl]acetate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2,5-Dioxoimidazolidin-4-yl)acetic acid
CAS:Formula:C5H6N2O4Purity:98%Color and Shape:LiquidMolecular weight:158.1121(2,5-Dioxoimidazolidin-4-yl)acetic acid
CAS:(2,5-Dioxoimidazolidin-4-yl)acetic acidFormula:C5H6N2O4Purity:95%Molecular weight:158.11(2,5-dioxoimidazolidin-4-yl)acetic acid
CAS:Formula:C5H6N2O4Purity:≥98%Color and Shape:Liquid, No data available.Molecular weight:158.113Hydantoin-5-acetic acid
CAS:Hydantoin-5-acetic acid is a molecule that has been studied for its potential use in the stabilization of polymers and plastics. It has shown antibacterial activity against certain bacterial strains including Escherichia coli and Staphylococcus aureus. The molecule has the ability to coordinate with metal ions such as copper, zinc, and iron. The protonation state of the molecule is dependent on the pH of the environment. Hydantoin-5-acetic acid can exist in two tautomeric forms: hydantoin or 5-hydantoin. Hydantoin-5-acetic acid can be used to determine the concentration of hydrogen in proteins through chromatographic methods. This molecule also has Langmuir adsorption isotherm properties, which give it potential for use in supramolecular structures.Formula:C5H6N2O4Purity:Min. 95%Molecular weight:158.11 g/mol



