CAS 5428-80-8

[2-(4-chlorophenyl)quinolin-4-yl](piperidin-2-yl)methanol

Description:

The chemical substance known as [2-(4-chlorophenyl)quinolin-4-yl](piperidin-2-yl)methanol, with the CAS number 5428-80-8, is a complex organic compound that features a quinoline core substituted with a 4-chlorophenyl group and a piperidin-2-ylmethanol moiety. This compound exhibits characteristics typical of heterocyclic compounds, including potential biological activity due to its structural components, which may interact with various biological targets. The presence of the chlorophenyl group can enhance lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the piperidine ring contributes to its basicity and may participate in hydrogen bonding, affecting solubility and reactivity. The compound's molecular structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or oncological conditions. However, specific properties such as melting point, solubility, and reactivity would require empirical data for precise characterization. Overall, this compound represents a class of molecules that could be of interest in drug discovery and development.

Formula: C₂₁H₂₁ClN₂O

InChI: InChI=1/C21H21ClN2O/c22-15-10-8-14(9-11-15)20-13-17(16-5-1-2-6-18(16)24-20)21(25)19-7-3-4-12-23-19/h1-2,5-6,8-11,13,19,21,23,25H,3-4,7,12H2

SMILES: c1ccc2c(c1)c(cc(c1ccc(cc1)Cl)n2)C(C1CCCCN1)O

Synonyms:

• (2-(4-Chlorophenyl)-4-Quinolinyl)(2-Piperidinyl)Methanol

Vacquinol-1

CAS: 5428-80-8

Vacquinol-1

Formula: C₂₁H₂₁ClN₂O

Purity: ≥98%

Molecular weight: 352.86

Ref: 54-BUP00974

2-(4-Chlorophenyl)-a-2-piperidinyl-4-quinolinemethanol

CAS: 5428-80-8

Formula: C₂₁H₂₁ClN₂O

Purity: 99%

Color and Shape: Liquid

Molecular weight: 352.8572

Ref: IN-DA00DLKR

(2-(4-Chlorophenyl)quinolin-4-yl)(piperidin-2-yl)methanol

CAS: 5428-80-8

(2-(4-Chlorophenyl)quinolin-4-yl)(piperidin-2-yl)methanol

Formula: C₂₁H₂₁ClN₂O

Purity: 99%

Molecular weight: 352.85723

Ref: 54-BISN0246

Vacquinol-1

CAS: 5428-80-8

Vacquinol-1 is an MKK4 activator, which rapidly and selectively induces glioma cell death.

Formula: C₂₁H₂₁ClN₂O

Purity: 99.92%

Color and Shape: Solid

Molecular weight: 352.86

Ref: TM-T7008

Vacquinol-1

CAS: 5428-80-8

(2-(4-Chlorophenyl)quinolin-4-yl)(piperidin-2-yl)methanol

Formula: C₂₁H₂₁ClN₂O

Purity: 99%

Molecular weight: 352.86

Ref: IN-DG287785

Vacquinol-1

CAS: 5428-80-8

Purity: ≥97%

Molecular weight: 352.8599854

Ref: 10-F600948

Vacquinol-1

Controlled Product

CAS: 5428-80-8

Formula: C₂₁H₂₁ClN₂O

Color and Shape: Neat

Molecular weight: 352.857

Ref: TR-V075000