CAS 54299-50-2
:(2E)-1-(2,4-dihydroxy-3,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one
Description:
The chemical substance known as (2E)-1-(2,4-dihydroxy-3,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one, with the CAS number 54299-50-2, is a type of chalcone, which is characterized by its structure featuring a phenylpropene moiety. This compound typically exhibits a yellow to orange color due to its conjugated double bond system, which allows for light absorption in the visible spectrum. It possesses multiple hydroxyl and methoxy functional groups, contributing to its potential antioxidant and anti-inflammatory properties. The presence of these substituents can enhance its solubility in organic solvents and influence its reactivity. Chalcones are known for their biological activities, including antimicrobial, anticancer, and anti-inflammatory effects, making this compound of interest in medicinal chemistry. Additionally, its structural features may allow for various chemical modifications, which can lead to the development of derivatives with enhanced biological activity or improved pharmacokinetic properties. Overall, this compound represents a significant class of organic molecules with diverse applications in pharmaceuticals and materials science.
Formula:C17H16O5
InChI:InChI=1/C17H16O5/c1-21-14-10-13(19)17(22-2)16(20)15(14)12(18)9-8-11-6-4-3-5-7-11/h3-10,19-20H,1-2H3/b9-8+
Synonyms:- 2',4'-Dihydroxy-3',6'-dimethoxychalcone
- 2-Propen-1-one, 1-(2,4-dihydroxy-3,6-dimethoxyphenyl)-3-phenyl-, (2E)-
- 54299-50-2
- (2E)-1-(2,4-Dihydroxy-3,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2',4'-Dihydroxy-3',6'-Dimethoxychalcone
CAS:2',4'-Dihydroxy-3',6'-Dimethoxychalcone is a chalcone derivative, which is a type of flavonoid compound. It is synthesized through organic chemistry methodologies, often derived from plant sources where chalcones naturally occur in various species. The mode of action for this compound involves the modulation of biological pathways, primarily through interactions with enzymes and receptors. These interactions can lead to effects such as antioxidation, anti-inflammatory, and potential antitumor activities.Formula:C17H16O5Purity:Min. 95 Area-%Molecular weight:300.31 g/mol
