CymitQuimica logo

CAS 54469-54-4

:

4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-amine

Description:
4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-amine, with the CAS number 54469-54-4, is an organic compound characterized by its complex heterocyclic structure, which includes both benzothiazole and thiazole moieties. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocyclic compounds. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial or anticancer agents. The presence of nitrogen and sulfur atoms in its structure can contribute to its reactivity and potential interactions with biological targets. Additionally, its molecular structure may allow for various functionalization, enabling the synthesis of derivatives with enhanced properties. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, this compound represents a class of thiazole derivatives that are valuable in medicinal chemistry and materials science.
Formula:C10H7N3S2
InChI:InChI=1/C10H7N3S2/c11-10-13-7(5-14-10)9-12-6-3-1-2-4-8(6)15-9/h1-5H,(H2,11,13)
SMILES:c1ccc2c(c1)nc(c1csc(=N)[nH]1)s2
Synonyms:
  • 2-Thiazolamine, 4-(2-Benzothiazolyl)-
  • 4-(1,3-Benzothiazol-2-yl)-1,3-thiazol-2-amine
Found 2 products.