CymitQuimica logo

CAS 544704-73-6

:

5-Benzoxazolol, 7-bromo-2-(3-fluoro-4-hydroxyphenyl)-

Description:
5-Benzoxazolol, 7-bromo-2-(3-fluoro-4-hydroxyphenyl)-, identified by its CAS number 544704-73-6, is a chemical compound that features a benzoxazole core, which is a bicyclic structure containing both benzene and oxazole rings. This compound is characterized by the presence of a bromine atom at the 7-position and a 3-fluoro-4-hydroxyphenyl group at the 2-position, contributing to its unique chemical properties. The fluorine atom enhances the compound's lipophilicity and may influence its biological activity, while the hydroxy group can participate in hydrogen bonding, potentially affecting solubility and reactivity. The presence of these functional groups suggests that the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Additionally, the compound's structural features may allow for various synthetic modifications, enabling the exploration of its derivatives for potential applications in drug development or material science.
Formula:C13H7BrFNO3
InChI:InChI=1S/C13H7BrFNO3/c14-8-4-7(17)5-10-12(8)19-13(16-10)6-1-2-11(18)9(15)3-6/h1-5,17-18H
InChI key:GGHZQYDERZQJFP-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C2=NC3=C(O2)C(=CC(=C3)O)Br)F)O
Synonyms:
  • 7-bromo-2-(3-fluoro-4-hydroxyphenyl)-1,3-benzoxazol-5-ol
Found 4 products.