CymitQuimica logo

CAS 5453-88-3

:

ethyl 1-methyl-2-oxocyclopentanecarboxylate

Description:
Ethyl 1-methyl-2-oxocyclopentanecarboxylate, with the CAS number 5453-88-3, is an organic compound characterized by its ester functional group, which is derived from the reaction of cyclopentanecarboxylic acid and ethanol. This compound features a cyclopentane ring with a ketone and a carboxylate group, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in flavor and fragrance applications. The presence of the oxo group (ketone) enhances its reactivity, allowing for various chemical transformations, such as nucleophilic additions. Ethyl 1-methyl-2-oxocyclopentanecarboxylate is soluble in organic solvents and exhibits moderate stability under standard conditions. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. However, as with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C9H14O3
InChI:InChI=1/C9H14O3/c1-3-12-8(11)9(2)6-4-5-7(9)10/h3-6H2,1-2H3
InChI key:UIZCVGDHOSROCR-UHFFFAOYSA-N
SMILES:CCOC(=O)C1(C)CCCC1=O
Synonyms:
  • Cyclopentanecarboxylic acid, 1-methyl-2-oxo-, ethyl ester
  • Ethyl 1-methyl-2-oxocyclopentanecarboxylate
Found 6 products.