CAS 5453-88-3
:ethyl 1-methyl-2-oxocyclopentanecarboxylate
Description:
Ethyl 1-methyl-2-oxocyclopentanecarboxylate, with the CAS number 5453-88-3, is an organic compound characterized by its ester functional group, which is derived from the reaction of cyclopentanecarboxylic acid and ethanol. This compound features a cyclopentane ring with a ketone and a carboxylate group, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in flavor and fragrance applications. The presence of the oxo group (ketone) enhances its reactivity, allowing for various chemical transformations, such as nucleophilic additions. Ethyl 1-methyl-2-oxocyclopentanecarboxylate is soluble in organic solvents and exhibits moderate stability under standard conditions. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. However, as with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C9H14O3
InChI:InChI=1/C9H14O3/c1-3-12-8(11)9(2)6-4-5-7(9)10/h3-6H2,1-2H3
SMILES:CCOC(=O)C1(C)CCCC1=O
Synonyms:- Cyclopentanecarboxylic acid, 1-methyl-2-oxo-, ethyl ester
- Ethyl 1-methyl-2-oxocyclopentanecarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
ETHYL1-METHYL-2-OXOCYCLOPENTANECARBOXYLATE
CAS:Formula:C9H14O3Purity:95%Color and Shape:LiquidMolecular weight:170.2057Ethyl 1-methyl-2-oxocyclopentanecarboxylate
CAS:Ethyl 1-methyl-2-oxocyclopentanecarboxylateFormula:C9H14O3Purity:95%Molecular weight:170.21ethyl 1-methyl-2-oxocyclopentane-1-carboxylate
CAS:Ethyl 1-methyl-2-oxocyclopentane-1-carboxylate is a cyclopentenone that has been shown to be effective against epidermoid carcinoma cells and lymphocytic leukemia. It has antitumor activity in vivo, with a good cytotoxicity profile. This compound binds to the DNA of tumor cells, causing mismatched base pairing through its diastereomeric interactions. This binding leads to disruption of the DNA helix, which causes cell death by apoptosis. Ethyl 1-methyl-2-oxocyclopentane-1-carboxylate also inhibits the growth of tissue culture cells. The toxic effects on these cells are dose dependent and can be reduced by irradiation or ethylene gas treatment.Formula:C9H14O3Purity:Min. 95%Molecular weight:170.21 g/mol




