CymitQuimica logo

CAS 54610-69-4

:

furan-2-carboximidamide hydrochloride

Description:
Furan-2-carboximidamide hydrochloride is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a carboximidamide functional group, which is indicative of its potential use in various chemical reactions and applications, particularly in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and chemical processes. The presence of the imidamide group suggests that it may exhibit properties such as hydrogen bonding and potential reactivity with electrophiles. Furan derivatives are known for their diverse biological activities, including antimicrobial and anticancer properties, making furan-2-carboximidamide hydrochloride of interest in pharmaceutical research. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, this compound represents a valuable entity in the field of organic chemistry and drug development.
Formula:C5H7ClN2O
InChI:InChI=1/C5H6N2O.ClH/c6-5(7)4-2-1-3-8-4;/h1-3H,(H3,6,7);1H
InChI key:BTQGDMLCRXCBGR-UHFFFAOYSA-N
SMILES:c1cc(C(=N)N)oc1.Cl
Found 4 products.