CAS 54624-57-6
:2-Bromobenzimidazole
Description:
2-Bromobenzimidazole is an organic compound characterized by its structure, which consists of a benzimidazole core substituted with a bromine atom at the second position of the benzene ring. This compound typically appears as a white to off-white solid and is known for its role in various chemical reactions and applications, particularly in medicinal chemistry and as a building block for synthesizing other compounds. It exhibits moderate solubility in organic solvents and is relatively stable under standard conditions. The presence of the bromine atom enhances its reactivity, making it useful in electrophilic substitution reactions. Additionally, 2-bromobenzimidazole may exhibit biological activity, which has led to research into its potential as a pharmaceutical agent. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-bromobenzimidazole serves as an important compound in both synthetic and medicinal chemistry contexts.
Formula:C7H5BrN2
InChI:InChI=1/C7H5BrN2/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10)
SMILES:c1ccc2c(c1)nc(Br)[nH]2
Synonyms:- 1H-Benzimidazole, 2-bromo-
- 2-Bromo-1H-benzimidazole
- 2-Bromo-1H-benzoimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Bromobenzimidazole
CAS:Formula:C7H5BrN2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:197.042-Bromobenzimidazole, 99%
CAS:Reactant in the synthesis of substituted benzimidazoles. 2-Bromobenzimidazole is the starting compound in the synthesis of polyhalogenobenzimidazoles. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information mayFormula:C7H5BrN2Purity:99%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:197.042-Bromo-1H-benzimidazole
CAS:2-Bromo-1H-benzimidazoleFormula:C7H5BrN2Purity:98%Color and Shape:Cream SolidMolecular weight:197.0322-Bromo-1H-benzo[d]imidazole
CAS:2-Bromo-1H-benzo[d]imidazole is a chemical compound with the chemical formula C6H4Br2N2. It is an aliphatic hydrocarbon that can be synthesized from a mixture of hydrogen bromide and benzene. 2-Bromo-1H-benzo[d]imidazole has shown potential as an antimicrobial agent, cancer treatment, and as a drug for inflammatory diseases. It has been found to bind to the bromodomain of proteins, inhibiting protein synthesis and leading to cell death by apoptosis.
Formula:C7H5BrN2Purity:Min. 95%Molecular weight:197.03 g/mol






