CAS 54865-21-3
:alanylleucylalanine
Description:
Alanylleucylalanine, identified by its CAS number 54865-21-3, is a synthetic dipeptide composed of the amino acids alanine and leucine. This compound features a sequence where alanine is linked to leucine, followed by another alanine, forming a tripeptide structure. Characteristically, it exhibits properties typical of peptides, such as solubility in water and the ability to form hydrogen bonds due to the presence of amine and carboxyl functional groups. Alanylleucylalanine may play a role in various biochemical processes, including protein synthesis and cellular signaling. Its structural configuration can influence its biological activity, stability, and interaction with other biomolecules. Additionally, like many peptides, it may be sensitive to changes in pH and temperature, which can affect its conformation and functionality. While specific applications of alanylleucylalanine may vary, peptides of this nature are often studied for their potential therapeutic uses and roles in nutrition and metabolism.
Formula:C12H23N3O4
InChI:InChI=1/C12H23N3O4/c1-6(2)5-9(15-10(16)7(3)13)11(17)14-8(4)12(18)19/h6-9H,5,13H2,1-4H3,(H,14,17)(H,15,16)(H,18,19)
SMILES:CC(C)CC(C(=NC(C)C(=O)O)O)N=C(C(C)N)O
Synonyms:- Ala-Leu-Ala
- Alanine, Alanylleucyl-
- Alanylleucylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
H-Ala-Leu-Ala-OH
CAS:H-Ala-Leu-Ala-OH is a synthetic peptide that has been shown to be an effective inhibitor of the human aminopeptidase. It is synthesized on a solid phase and then purified from the resin. The H-Ala-Leu-Ala-OH peptide was found to have a ph optimum of 7 and can be used for the treatment of skin infections caused by fungi such as Metarhizium anisopliae, which are resistant to conventional treatments. This peptide inhibits the synthesis of proteins in fungal cells and prevents the growth of the fungus.Formula:C12H23N3O4Purity:Min. 95%Molecular weight:273.33 g/mol
