CymitQuimica logo

CAS 5487-93-4

:

4,4'-Biphenyldiboronic acid bis(neopentyl glycol) cylic ester

Description:
4,4'-Biphenyldiboronic acid bis(neopentyl glycol) cyclic ester, with the CAS number 5487-93-4, is a chemical compound characterized by its unique structure that includes two biphenyl groups connected by a diboronic acid moiety and esterified with neopentyl glycol. This compound typically exhibits properties associated with boron-containing compounds, such as potential applications in organic synthesis and materials science. It is likely to be soluble in organic solvents due to the presence of the neopentyl glycol moieties, which enhance its solubility and reactivity. The cyclic ester formation suggests that it may have a stable structure, potentially making it useful in polymer chemistry or as a building block for more complex molecules. Additionally, the presence of boron may impart unique reactivity, particularly in cross-coupling reactions or as a ligand in coordination chemistry. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C22H28B2O4
InChI:InChI=1/C22H28B2O4/c1-21(2)13-25-23(26-14-21)19-9-5-17(6-10-19)18-7-11-20(12-8-18)24-27-15-22(3,4)16-28-24/h5-12H,13-16H2,1-4H3
InChI key:NJXUWONHNYJPMY-UHFFFAOYSA-N
SMILES:CC1(C)COB(c2ccc(cc2)c2ccc(cc2)B2OCC(C)(C)CO2)OC1
Synonyms:
  • 2,2'-Biphenyl-4,4'-Diylbis(5,5-Dimethyl-1,3,2-Dioxaborinane)
Found 5 products.