CAS 54899-89-7
:Quinolineisoamyliodide; 98%
Description:
Quinolineisoamyliodide, with the CAS number 54899-89-7, is a chemical compound that belongs to the class of organic compounds known as quinolines. It is characterized by its structure, which includes a quinoline moiety and an isoamyl iodide group. This compound typically appears as a yellow to brownish liquid or solid, depending on its purity and specific formulation. It is known for its applications in organic synthesis, particularly as a reagent in various chemical reactions, including those involving nucleophilic substitutions. Quinoline derivatives are often studied for their biological activities, including potential antimicrobial and antitumor properties. The compound is generally handled with care due to its potential toxicity and the presence of iodine, which can pose health risks. Proper safety measures, including the use of personal protective equipment and adequate ventilation, are essential when working with this substance. As with many organic compounds, it is important to store it in a cool, dry place, away from light and incompatible materials.
Formula:C14H18IN
InChI:InChI=1/C14H18N.HI/c1-12(2)9-11-15-10-5-7-13-6-3-4-8-14(13)15;/h3-8,10,12H,9,11H2,1-2H3;1H/q+1;/p-1
Synonyms:- Quinoline iso-amyl iodide
- 1-(3-Methylbutyl)Quinolinium Iodide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Quinoline Isoamyl Iodide
CAS:Formula:C14H18INPurity:>98.0%(T)(HPLC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:327.21Quinoline Isoamyl Iodide
CAS:Quinoline Isoamyl IodideFormula:C14H18INPurity:>98.0%Molecular weight:327.21Quinoline iso-Amyl iodide
CAS:Formula:C14H18INPurity:98.0%Color and Shape:SolidMolecular weight:327.2039



