CAS 5497-76-7
:L-Proline tert-butyl ester hydrochloride
Description:
L-Proline tert-butyl ester hydrochloride is a chemical compound that serves as a derivative of the amino acid proline. It is characterized by the presence of a tert-butyl ester group, which enhances its solubility and stability compared to the parent amino acid. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols. The hydrochloride form indicates that it is a salt, which can influence its reactivity and solubility properties. L-Proline tert-butyl ester hydrochloride is often utilized in organic synthesis, particularly in peptide synthesis and as a chiral building block due to the presence of the proline moiety. Its structure allows for specific interactions in biological systems, making it of interest in medicinal chemistry and drug development. Additionally, the tert-butyl group can provide steric hindrance, which may affect the compound's reactivity and interaction with other molecules. Overall, this compound is valuable in both academic research and industrial applications.
Formula:C9H17NO2·ClH
InChI:InChI=1S/C9H17NO2.ClH/c1-9(2,3)12-8(11)7-5-4-6-10-7;/h7,10H,4-6H2,1-3H3;1H/t7-;/m0./s1
InChI key:InChIKey=IUUYANMOEMBTBV-FJXQXJEOSA-N
SMILES:C(OC(C)(C)C)(=O)[C@@H]1CCCN1.Cl
Synonyms:- (S)-Proline tert-butyl ester hydrochloride
- <span class="text-smallcaps">L</span>-Proline tert-butyl ester hydrochloride
- <span class="text-smallcaps">L</span>-Proline, 1,1-dimethylethyl ester, hydrochloride
- <span class="text-smallcaps">L</span>-Proline, 1,1-dimethylethyl ester, hydrochloride (1:1)
- H-Pro-Obut Hcl
- H-Pro-OtBu・HCl
- H-Pro-Otbu Hcl
- H-Pro-Otbu Hydrochloride
- L-Proline T-Butyl Ester Hydrochloride
- L-Proline T-Butyl Ester Hydrochloride Salt
- L-Proline T-butyl ester HCl
- L-Proline, 1,1-Dimethylethyl Ester,Hydrochloride
- Proline, tert-butyl ester, hydrochloride
- Proline, tert-butyl ester, hydrochloride, <span class="text-smallcaps">L</span>-
- Proootbu.hcl
- Tert-Butyl (2S)-Pyrrolidine-2-Carboxylate Hydrochloride
- tert-Butyl (S)-pyrrolidine-2-carboxylate hydrochloride
- tert-Butyl <span class="text-smallcaps">L</span>-prolinate hydrochloride
- tert-butyl L-prolinate hydrochloride
- Proline, tert-butyl ester, hydrochloride, L-
- L-Proline tert.butyl ester hydrochloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
L-Proline tert-Butyl Ester Hydrochloride
CAS:Formula:C9H17NO2·HClPurity:>98.0%(T)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:207.70L-Proline tert-Butyl Ester Hydrochloride
CAS:L-Proline tert-Butyl Ester HydrochlorideFormula:C9H18ClNO2Purity:>98%Molecular weight:207.7L-Proline tert-butyl ester hydrochloride
CAS:L-Proline tert-butyl ester hydrochloride (tert-Butyl L-prolinate hydrochloride) is a bioactive compound renowned for its ability to inhibit the activity of cysteine and tissue proteases, making it extensively used in the research and development of protease inhibitors. Its properties confer significant importance within the biochemical field.Formula:C9H18ClNO2Molecular weight:207.70





