CAS 550-24-3
:Embelin
Description:
Embelin, with the CAS number 550-24-3, is a naturally occurring compound classified as a benzoquinone derivative. It is primarily extracted from the fruits of the Embelia ribes plant, which is known for its traditional medicinal uses. Embelin exhibits a range of biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in pharmacological research. The compound is characterized by its molecular formula, which typically includes carbon, hydrogen, and oxygen atoms, contributing to its structural properties. Embelin is often studied for its potential therapeutic applications, particularly in the context of cancer treatment and metabolic disorders. Additionally, it has been noted for its ability to modulate various biochemical pathways, which further enhances its significance in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in its application and study. Overall, embelin represents a valuable compound in both natural product chemistry and pharmaceutical development.
Formula:C17H26O4
InChI:InChI=1S/C17H26O4/c1-2-3-4-5-6-7-8-9-10-11-13-16(20)14(18)12-15(19)17(13)21/h12,18,21H,2-11H2,1H3
InChI key:InChIKey=IRSFLDGTOHBADP-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCC)C=1C(=O)C(O)=CC(=O)C1O
Synonyms:- 2,5-Cyclohexadiene-1,4-dione, 2,5-dihydroxy-3-undecyl-
- 2,5-Dihydroxy-3-Undecylcyclohexa-2,5-Diene-1,4-Dione
- 2,5-Dihydroxy-3-undecyl-1,4-benzoquinone
- 2,5-Dihydroxy-3-undecyl-2,5-cyclohexadiene-1,4-dione
- 2,5-Dihydroxy-3-undecyl-p-benzoquinone
- 2,5-Dihydroxy-3-undecylcyclohexa-2,5-dien-1,4-dione
- Embelic acid
- Embelin
- Emberine
- NSC 91874
- p-Benzoquinone, 2,5-dihydroxy-3-undecyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
Embelin
CAS:An inhibitor of XIAP (X-linked inhibitor-of-apoptosis protein) that contains antitumor and anti-inflammatory activity This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The or
Formula:C17H26O4Molecular weight:294.4Embelin
CAS:Formula:C17H26O4Purity:>95.0%(T)(HPLC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:294.39Embelin
CAS:Embelin (Embelic acid), isolated from the Japanese Ardisia herb, is an inhibitor of the X-linked inhibitor of apoptosis (IC50: 4.1 uM).Formula:C17H26O4Purity:97.07% - 99.88%Color and Shape:SolidMolecular weight:294.39Embelin
CAS:QuinoneFormula:C17H26O4Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:294.39Embelin
CAS:Controlled ProductApplications Embelin is a natural benzoquinone found in plants of the Myrsinaceae family. Embelin has a wide range of biological activity as it inhibits the growth of bacteria, fungi, protozoa and parasites. Embelin also displays contraceptive and pro-apoptotic properties.
References Stasiuk, M. et al.: Glob. J. Biochem., 2, 262 (2011); Brahmeshwari, G. et al.: Adv. Plant Sci., 24, 467 (2011); Hu, R. et al.: Med. Oncol., 28, 1598 (2011);Formula:C17H26O4Color and Shape:OrangeMolecular weight:294.39Embelin
CAS:Embelin is a phytochemical compound that functions as an active ingredient derived from the plant Embelia ribes. This compound, known for its quinone structure, operates primarily through the inhibition of X-linked inhibitor of apoptosis protein (XIAP), which plays a crucial role in the regulation of apoptotic pathways. By targeting XIAP, Embelin promotes apoptosis in cancer cells, making it a potential candidate for anticancer therapies. Additionally, Embelin exhibits anti-inflammatory, analgesic, and antioxidant properties through various pathways, including modulation of inflammatory cytokine production and reactive oxygen species scavenging.Formula:C17H26O4Purity:Min. 95%Color and Shape:PowderMolecular weight:294.39 g/mol










