CymitQuimica logo

CAS 55004-77-8

:

4-hydroxy-6,7-dimethyl-2H-chromen-2-one hydrate

Description:
4-Hydroxy-6,7-dimethyl-2H-chromen-2-one hydrate, also known as a derivative of flavone, is a chemical compound characterized by its chromone backbone, which features a hydroxyl group and two methyl groups at specific positions on the aromatic ring. This compound typically exhibits a yellow to orange color, indicative of its flavonoid structure, and is soluble in organic solvents such as ethanol and methanol, while showing limited solubility in water. The presence of the hydroxyl group contributes to its potential antioxidant properties, making it of interest in various biological and pharmaceutical applications. Additionally, the hydrate form suggests that it can associate with water molecules, which may influence its stability and reactivity. Its CAS number, 55004-77-8, allows for precise identification in chemical databases. Overall, this compound's unique structural features and properties make it a subject of interest in research related to natural products and medicinal chemistry.
Formula:C11H12O4
InChI:InChI=1/C11H10O3.H2O/c1-6-3-8-9(12)5-11(13)14-10(8)4-7(6)2;/h3-5,12H,1-2H3;1H2
InChI key:AYHZQBMBPNZPEY-UHFFFAOYSA-N
SMILES:Cc1cc2c(cc(=O)oc2cc1C)O.O
Found 3 products.