CAS 55052-24-9

7-Azaindole-7-oxide

Description:

7-Azaindole-7-oxide is a heterocyclic organic compound characterized by its structure, which features a nitrogen atom incorporated into the indole framework. This compound is notable for the presence of an oxide functional group at the 7-position of the azaindole ring, which contributes to its unique chemical properties. It typically appears as a solid or crystalline substance and is soluble in various organic solvents. The presence of the nitrogen atom in the ring enhances its basicity and potential reactivity, making it of interest in various chemical applications, including medicinal chemistry and materials science. 7-Azaindole-7-oxide can participate in various chemical reactions, such as oxidation and substitution, and may serve as a building block for the synthesis of more complex molecules. Its derivatives are often explored for biological activity, including potential pharmaceutical applications. As with many nitrogen-containing heterocycles, it may exhibit interesting electronic properties, making it a subject of study in the field of organic electronics and photonics.

Formula: C₇H₆N₂O

InChI: InChI=1/C7H6N2O/c10-9-5-1-2-6-3-4-8-7(6)9/h1-5,8H

SMILES: c1cc2cc[nH]c2n(=O)c1

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridin-7-oxid
• 1H-Pyrrolo[2,3-b]pyridine 7-oxide
• 1H-pyrrolo[2,3-b]pyridine-7-oxyde
• 7-Oxide-7-azaindole

1H-Pyrrolo[2,3-b]pyridine 7-Oxide

CAS: 55052-24-9

Formula: C₇H₆N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 134.1353

Ref: IN-DA0034EJ

7-Azaindole 7-oxide

CAS: 55052-24-9

7-Azaindole 7-oxide

Purity: 97%

Molecular weight: 134.14g/mol

Ref: 54-OR54331

1H-Pyrrolo[2,3-b]pyridine 7-Oxide

CAS: 55052-24-9

Formula: C₇H₆N₂O

Purity: >95.0%(GC)(T)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 134.14

Ref: 3B-P2735

7-Azaindole-7-oxide

CAS: 55052-24-9

Formula: C₇H₆N₂O

Purity: 95%

Color and Shape: Crystalline Powder,Powder

Molecular weight: 134.138

Ref: 10-F048250

1H-Pyrrolo[2,3-b]pyridine 7-Oxide

Controlled Product

CAS: 55052-24-9

Applications 1H-Pyrrolo[2,3-b]pyridine 7-Oxide (cas# 55052-24-9) is a compound useful in organic synthesis.

Formula: C₇H₆N₂O

Color and Shape: Neat

Molecular weight: 134.14

Ref: TR-P998600