CAS 55052-24-9
:7-Azaindole-7-oxide
Description:
7-Azaindole-7-oxide is a heterocyclic organic compound characterized by its structure, which features a nitrogen atom incorporated into the indole framework. This compound is notable for the presence of an oxide functional group at the 7-position of the azaindole ring, which contributes to its unique chemical properties. It typically appears as a solid or crystalline substance and is soluble in various organic solvents. The presence of the nitrogen atom in the ring enhances its basicity and potential reactivity, making it of interest in various chemical applications, including medicinal chemistry and materials science. 7-Azaindole-7-oxide can participate in various chemical reactions, such as oxidation and substitution, and may serve as a building block for the synthesis of more complex molecules. Its derivatives are often explored for biological activity, including potential pharmaceutical applications. As with many nitrogen-containing heterocycles, it may exhibit interesting electronic properties, making it a subject of study in the field of organic electronics and photonics.
Formula:C7H6N2O
InChI:InChI=1/C7H6N2O/c10-9-5-1-2-6-3-4-8-7(6)9/h1-5,8H
SMILES:c1cc2cc[nH]c2n(=O)c1
Synonyms:- 1H-Pyrrolo[2,3-b]pyridin-7-oxid
- 1H-Pyrrolo[2,3-b]pyridine 7-oxide
- 1H-pyrrolo[2,3-b]pyridine-7-oxyde
- 7-Oxide-7-azaindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H-Pyrrolo[2,3-b]pyridine 7-oxide
CAS:1H-Pyrrolo[2,3-b]pyridine 7-oxideFormula:C7H6N2OPurity:97%Molecular weight:134.147-Azaindole 7-oxide
CAS:7-Azaindole 7-oxideFormula:C7H6N2OPurity:97%Color and Shape:SolidMolecular weight:134.135341H-Pyrrolo[2,3-b]pyridine 7-Oxide
CAS:Formula:C7H6N2OPurity:97%Color and Shape:SolidMolecular weight:134.13531H-Pyrrolo[2,3-b]pyridine 7-Oxide
CAS:Formula:C7H6N2OPurity:>95.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:134.147-Azaindole-7-oxide
CAS:Formula:C7H6N2OPurity:95%Color and Shape:Crystalline Powder,PowderMolecular weight:134.1381H-Pyrrolo[2,3-b]pyridine 7-Oxide
CAS:Controlled ProductApplications 1H-Pyrrolo[2,3-b]pyridine 7-Oxide (cas# 55052-24-9) is a compound useful in organic synthesis.
Formula:C7H6N2OColor and Shape:NeatMolecular weight:134.14





