CAS 55052-28-3
:4-Chloro-7-azaindole
Description:
4-Chloro-7-azaindole is a heterocyclic organic compound characterized by the presence of a chlorine atom and a nitrogen atom within its indole-like structure. It features a bicyclic system that includes a pyrrole and a pyridine ring, making it a member of the azaindole family. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The chlorine substituent at the 4-position can influence its reactivity and solubility, while the nitrogen atom at the 7-position contributes to its basicity and potential for forming hydrogen bonds. 4-Chloro-7-azaindole may exhibit various biological activities, including antimicrobial and anticancer properties, making it a subject of interest in drug discovery. Its synthesis often involves multi-step organic reactions, and it can be characterized using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity.
Formula:C7H5ClN2
InChI:InChI=1/C7H5ClN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10)
SMILES:c1cnc2c1c(cc[nH]2)Cl
Synonyms:- Iflab-Bb F2108-0145
- 1H-pyrrolo[2,3-B]pyridine, 4-Chloro-
- 4-Chloro-1H-pyrrolo[2,3-B]pyridine
- 4-Chloro-1H-pyrrolo[2,3-b]pyridin
- 1,3-dihydro-2H-benzimidazol-2-one
- Chloro-7-azaindole, 4-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Chloro-7-azaindole, 98%
CAS:A useful intermediate for drug discovery research such as used in the synthesis of 7-azaindole derivatives, synthetic cytokinin analogues. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to thFormula:C7H5ClN2Purity:98%Color and Shape:Off-white, SolidMolecular weight:152.584-Chloro-7-azaindole
CAS:4-Chloro-7-azaindoleFormula:C7H5ClN2Purity:93%Color and Shape:SolidMolecular weight:152.5834-Chloro-7-azaindole
CAS:4-Chloro-7-azaindoleFormula:C7H5ClN2Purity:99%Color and Shape:Beige Solid-PowderMolecular weight:152.58099Ref: IN-DA0033ZQ
1g20.00€5g28.00€10g38.00€25g68.00€100g165.00€5kg4,205.00€10kg8,178.00€25kg19,529.00€4-Chloro-1H-pyrrolo[2,3-b]pyridine
CAS:Formula:C7H5ClN2Purity:>97.0%(GC)(T)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:152.584-Chloro-7-azaindole
CAS:Controlled ProductApplications A useful intermediate for drug discovery research.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Caldwell, J., et al.: Tet. Lett., 48, 1527 (2007)Formula:C7H5ClN2Color and Shape:NeatMolecular weight:152.584-Chloro-7-azaindole
CAS:4-Chloro-7-azaindole (4CA) is a molecule that has been shown to have significant cytotoxicity against cancer cells in vitro. 4CA inhibits the growth of cancer cells by binding to their DNA, preventing the synthesis of new DNA strands and leading to cell death. The inhibitory effect of 4CA on cancer cells can be attributed to its ability to bind to nitrogen atoms in the molecule's skeleton. This binding prevents the formation of hydrogen bonds between the molecule and other molecules or proteins, which are necessary for the synthesis of new DNA strands. 4CA has been shown to be active against human ovarian carcinoma and carcinoma cell lines in vitro.Formula:C7H5N2ClPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:152.58 g/mol






