CymitQuimica logo

CAS 551930-53-1

:

5-isoxazol-5-ylthiophene-2-sulfonyl chloride

Description:
5-Isoxazol-5-ylthiophene-2-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes an isoxazole ring and a thiophene moiety, both of which contribute to its reactivity and potential applications in organic synthesis. The presence of a sulfonyl chloride functional group makes it a versatile reagent, particularly useful in the formation of sulfonamides and other sulfonyl derivatives. This compound is typically a solid at room temperature and may exhibit moderate to high solubility in polar organic solvents. Its reactivity is influenced by the electrophilic nature of the sulfonyl chloride, allowing it to participate in nucleophilic substitution reactions. Additionally, the isoxazole and thiophene rings can provide interesting electronic properties, making this compound of interest in medicinal chemistry and materials science. Safety precautions should be taken when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or amines.
Formula:C7H4ClNO3S2
InChI:InChI=1/C7H4ClNO3S2/c8-14(10,11)7-2-1-6(13-7)5-3-4-9-12-5/h1-4H
SMILES:c1cc(sc1c1ccno1)S(=O)(=O)Cl
Synonyms:
  • 2-Thiophenesulfonyl chloride, 5-(5-isoxazolyl)-
  • 5-(1,2-Oxazol-5-yl)thiophene-2-sulfonyl chloride
Found 2 products.