CAS 55242-64-3
:3,7-Dihydro-3-methyl-7-propyl-1H-purine-2,6-dione
Description:
3,7-Dihydro-3-methyl-7-propyl-1H-purine-2,6-dione, also known as a derivative of purine, is a chemical compound characterized by its bicyclic structure, which consists of a fused imidazole and pyrimidine ring. This compound features a methyl group and a propyl group at the 3 and 7 positions, respectively, contributing to its unique properties. It is classified as a purine derivative, which are important in biochemistry, particularly in the structure of nucleotides and nucleic acids. The presence of carbonyl groups in the 2 and 6 positions enhances its reactivity and potential biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. As with many purine derivatives, it may interact with biological systems, influencing metabolic pathways or serving as a precursor for other biologically relevant molecules. Further studies are often required to fully elucidate its biological roles and potential applications.
Formula:C9H12N4O2
InChI:InChI=1S/C9H12N4O2/c1-3-4-13-5-10-7-6(13)8(14)11-9(15)12(7)2/h5H,3-4H2,1-2H3,(H,11,14,15)
InChI key:InChIKey=MHNVSFOURBQRPK-UHFFFAOYSA-N
SMILES:C(CC)N1C2=C(N(C)C(=O)NC2=O)N=C1
Synonyms:- 1H-Purine-2,6-dione, 3,7-dihydro-3-methyl-7-propyl-
- 3,7-Dihydro-3-methyl-7-propyl-1H-purine-2,6-dione
- 3-Methyl-7-Propyl-Xanthine
- 3-Methyl-7-n-propylxanthine
- 3-Methyl-7-propyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione
- 3-Methyl-7-propyl-3,7-dihydro-1H-purine-2,6-dione
- 3-Methyl-7-propylpurine-2,6-dione
- 6,8-Dichloro-9-(tetrahydro-2H-pyran-2-yl)purine
- 3-Methyl-7-propylxanthine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Methyl-7-propylxanthine
CAS:3-Methyl-7-propylxanthineFormula:C9H12N4O2Purity:98%Molecular weight:208.223-Methyl-7-propylxanthine
CAS:Formula:C9H12N4O2Purity:96%Color and Shape:SolidMolecular weight:208.21723-Methyl-7-propylxanthine
CAS:Controlled ProductFormula:C9H12N4O2Color and Shape:NeatMolecular weight:208.223-Methyl-7-propylxanthine
CAS:Controlled ProductFormula:C9H12N4O2Color and Shape:NeatMolecular weight:208.223-Methyl-7-propylxanthine
CAS:Controlled Product3-Methyl-7-propylxanthine is a xanthine derivative that is used in the manufacture of medicines for animals. It has been shown to be a competitive inhibitor of theophylline, which is a bronchodilator. 3-Methyl-7-propylxanthine has been shown to bind to theophylline at sites on the enzyme that are not occupied by caffeine and also inhibits its ability to stimulate adenosine receptors. This compound was synthesized in an attempt to identify compounds that would have fewer side effects than caffeine, such as increased heart rate, nervousness, and stomach irritation. The synthesis of 3-methyl-7-propylxanthine involved modifying the xanthinone ring with substituents that would cause steric interactions with endogenous adenosine when it binds to its receptor. The reaction temperature was also manipulated so that supramolecular structures were formed and energy metabolism was enhanced.Formula:C9H12N4O2Purity:Min. 95%Color and Shape:PowderMolecular weight:208.22 g/mol






