CAS 55271-46-0
:4-Amino-3(2H)-pyridazinone
Description:
4-Amino-3(2H)-pyridazinone, with the CAS number 55271-46-0, is a heterocyclic organic compound characterized by a pyridazine ring structure that features an amino group at the 4-position and a keto group at the 3-position. This compound is typically a white to off-white crystalline solid, and it is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical applications. The presence of the amino group contributes to its basicity and potential reactivity, making it a candidate for further chemical modifications. 4-Amino-3(2H)-pyridazinone is of interest in medicinal chemistry and may exhibit biological activity, including potential use in pharmaceuticals. Its structural properties allow for interactions with biological targets, which can be explored in drug development. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the functional groups present in its structure. Overall, this compound represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C4H5N3O
InChI:InChI=1S/C4H5N3O/c5-3-1-2-6-7-4(3)8/h1-2H,(H2,5,6)(H,7,8)
InChI key:InChIKey=VROMXVIODDASTK-UHFFFAOYSA-N
SMILES:NC=1C(=O)NN=CC1
Synonyms:- 5-Aminopyridazin-6(1H)-one
- 4-Amino-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 4-amino-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3(2H)-Pyridazinone,4-amino-(6CI,9CI)
CAS:3(2H)-Pyridazinone,4-amino-(6CI,9CI)Formula:C4H5N3OPurity:98%Molecular weight:111.14-Aminopyridazin-3(2H)-one
CAS:Formula:C4H5N3OPurity:98%Color and Shape:SolidMolecular weight:111.10204-Aminopyridazin-3(2H)-one
CAS:4-Aminopyridazin-3(2H)-oneFormula:C4H5N3OPurity:95%Molecular weight:111.14-Aminopyridazin-3(2H)-one
CAS:Formula:C4H5N3OPurity:95%Color and Shape:SolidMolecular weight:111.1044-Aminopyridazin-3(2H)-one
CAS:4-Aminopyridazin-3(2H)-one is an antiplatelet drug that has been shown to have a pharmacological effect on the central nervous system. It is also used as a chemotherapeutic agent for the treatment of certain types of cancer. 4-Aminopyridazin-3(2H)-one contains two nitrogen atoms that are substituted with methyl groups, which can be hydrolyzed by liver enzymes to form pyridazine and 4-aminopyridine. 4-Aminopyridazin-3(2H)-one inhibits bacterial growth by inhibiting protein synthesis and cell division at the ribosome level. This drug also has antimicrobial activity against Gram-positive bacteria and fungi, but is not active against Gram-negative bacteria such as Escherichia coli.
Formula:C4H5N3OPurity:Min. 95%Color and Shape:White To Yellow SolidMolecular weight:111.1 g/molRef: 3D-FA141613
Discontinued product




